answersLogoWhite

0


Best Answer

The IUPAC name of this 'khat'-like (cathinone) drug is

(±)-1-(4-methylphenyl)-2-methylaminopropan-1-oneformula and group names beneath it between (..) marks

CH3-(paraC6H4)-C(=O)-CH(CH3)-(NHCH3)

(methyl...phenyl....propan-1-on.....methylamino)

User Avatar

Wiki User

14y ago
This answer is:
User Avatar
More answers
User Avatar

Wiki User

11y ago

chemical and physical properties of ecstacy

This answer is:
User Avatar

User Avatar

Wiki User

13y ago

Lysergic acid diethylamide

Formula = C20H25N3O

This answer is:
User Avatar

User Avatar

Wiki User

13y ago

C11+H16+Cl+NO2 → Methylenedioxy methamphetamine

This answer is:
User Avatar

User Avatar

Wiki User

11y ago

The chemical formula for ecstasy is C11H15NO2

This answer is:
User Avatar

Add your answer:

Earn +20 pts
Q: What is the chemical formula of ecstasy?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

What in mdma?

MDMA is an abbreviation for 3,4-Methylenedioxymethamphetamine which is one single chemical. (C11H15NO2) Just like Water is name for the chemical dihydrogenmonoxide. (chemical formula: H2O) Ecstasy is the name for 3,4-Methylenedioxymethamphetamine (MDMA for short) (Chemical formula: C11H15NO2) They are their own chemicals. For example if someone gives you a bottle of alcohol and calls it water they are lying or they don't know what water is, just like if someone gives you something that isn't MDMA and call it Ecstasy, they are lying or they don't know what Ecstasy is.


From what chemical did ecstasy made from?

MDMA (methalynedioxymethamphetamine)


Scientific name of ecstasy?

Ecstasy's scientific name is 3,4-methylenedioxymethamphetamine (MDMA).


What is the formula for chemical energy?

Energy has no chemical formula as it is not a chemical.


Does mdpv have ecstasy in it and is it legal?

MDPV is a completely different and separate chemical from ecstasy (MDMA), and is schedule I (no legal use) in the US


What is the chemical name for formula?

chemical formula


What is the chemical formula for SnCl4?

That is the chemical formula. SnCl4 is the chemical formula for tin(IV) chloride.


What are the examples of salt and their chemical formula?

Copper sulfate, chemical formula CuSO4Sodium chloride, chemical formula NaClSodium chromate, chemical formula H2CrO4Mercury sulfide, chemical formula HgSCalcium carbonate,CaCO3


Is CO2 an example of a chemical equation or a chemical formula?

It is a chemical formula.


What is chemical formula for soap nut powder?

it has no chemical formula. it is a mixture. only compounds have a chemical formula.


What is chemical formula for cysteine?

The chemical formula of cysteine is HO2CCH(NH2)CH2SH.


What chemical formula H20?

H2O is 2 hydrogens plus 1 oxygen and that makes the chemical formula for water.