0
I assume you mean CH2=C=CH2 or 1,2-propadiene. The molecule has two equally electronegative substituents attached to the central carbon, so no it is not polar. If it was CH2=C=O, then yes it would be polar, because the oxygen atom pulling the electron cloud toward itself, thus making it slightly negative which make he molecule polar.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
How many sigma and pi bond in H2C equals C equals CH2?
H2C=C=CH2, 6 sigma and 2 pi bonds.
Is FCH3 a nonpolar molecule?
No. It is a polar molecule.
Is benzil a polar molecule?
It might be tempting to think Benzil is a polar molecule because of the C=O bonds, but the high level of symmetry in the molecule cancels out any overall dipole and leaves the molecule non-polar.
Is cf3cl polar?
CF3Cl is a polar molecule. There are three C-F polar bond and and C-Cl polar bond. The bond dipoles do not cancel out and hence the compound is a polar molcule.
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
How many sigma and pi bond in H2C equals C equals CH2?
H2C=C=CH2, 6 sigma and 2 pi bonds.
Is O-C-S molecule polar?
it is polar
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
Is FCH3 a nonpolar molecule?
No. It is a polar molecule.
What type of molecule is C20H40O2?
Well, it's organic. Past that it's difficult to say with certainty. It could be a cyclic diether or diol, it could be an ester, it could be an alkene diether or diol ... the molecular formula alone doesn't provide enough information to be sure.
Is benzil a polar molecule?
It might be tempting to think Benzil is a polar molecule because of the C=O bonds, but the high level of symmetry in the molecule cancels out any overall dipole and leaves the molecule non-polar.
What is propene condensed structural formula?
Ch2chch3 c=c-c
In a polar molecule such as water?
D. both b and c
What is this C-C-C-O-C-C?
this is nothing actually is... CH3-CH2-CH2-O-CH2-CH3 ethyl methyl ether....
What is the structure of ethyl octanoate?
Ch3 -ch2 -o-c(o)-ch2-ch2-ch2-ch2-ch2-ch2-ch3
Is cf3cl polar?
CF3Cl is a polar molecule. There are three C-F polar bond and and C-Cl polar bond. The bond dipoles do not cancel out and hence the compound is a polar molcule.
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
