0
Yes it is, oleic acid (18 carbon Chain carboxylic acid) will react with the Sodium Hydroxide (NaOH) and produce a new metal salt carboxylic acid.
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
Is iron III oxide soluble in sodium hydroxide?
No, it is hardly soluble in sodium hydroxide though it is amphoteric. It's better in (hydrochloric) acid.
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
What salt is made when sodium hydroxide reacts with hydroxide acid?
There is no reaction. "Hydroxide acid" is water, which does not react with sodium hydroxide.
What is the chemical equation for Pyrogallic acid an sodium hydroxide?
Pyrogallic acid and sodium hydroxide is used to provide anaerobiosis.
Can you store 6.0 N Hydrochloric acid with sodium hydroxide?
Can you store 6.0 N Hydrochloric acid with sodium hydroxide?
How do you saponify Oleic Acid?
add sodium or potassium hydroxide.
Does ethanoic acid soluble in water and sodium hydroxide?
Ethanoic acid is fully soluble in water, but it will react with sodium hydroxide.
Is oleic acid soluble dilute NaOH?
Yes it is. Sodium oleate is formed.
Is iron III oxide soluble in sodium hydroxide?
No, it is hardly soluble in sodium hydroxide though it is amphoteric. It's better in (hydrochloric) acid.
Is ethanoic acid soluble in sodium hydroxide?
Not really. Ethanoic acid and just about any other acid will react with sodium hydroxide rather than dissolve in it.
Is beryllium solubility?
Beryllium metal is soluble in hydrochloric acid, sulphuric acid, sodium hydroxide, potassium hydroxide, etc.
Is salicylic acid soluble in 10 percent sodium hydroxide?
what is computer
Is glacial acetic acid soluble in sodium hydroxide?
Glacial acetic acid reacts with sodium hydroxide to give sodium acetate and water CH3COOH + NaOH = CH3COONa + H2O
Is an iye and acid or base?
A Base . More correctly it is a soluble base, 'Lye' is the commercial name used in soap making for 'sodium hydroxide'. Sodium hydroxide is an alkali ( a soluble base).
Is oleic acid soluble in ethyl alcohol?
Yes
Why is the reaction of calcium hydroxide and sulfuric acid different from sodium hydroxide and sulfuric acid?
The reactions of sodium hydroxide and calcium hydroxide with sulfuric acid will produce sodium sulfate and calcium sulfate respectively (water will be another product in both reactions. Sodium sulfate is soluble in water and so will remain in solution. Calcium sulfate, however, is insoluble and will precipitate as a solid.
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
