0
It does not have a high toxicity level. However, ingesting it will make you ill,
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
What is the structural formula of sodium lauryl sulphate?
See the link below.
What is sodium lauryl sulfoacetate?
Sodium lauryl sulfoacetate is a component of some cosmetics (as a surfactant agent).
What is the common name of Sodium Laureth Ether Sulphate?
it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be
Is sodium laureth sulfate an ionic or covalent compound?
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.
What are the uses of sodium lauryl sulfate?
Sodium lauryl sulfate is a surfactant. Almost all the uses of the compound revolve around making detergent out of it.
Does Dove Soap contain sodium lauryl sulphate?
no
What is a substance containing sodium lauryl sulphate?
shampoo
What does SLS means in Mercedes Benz SLS?
sodium lauryl sulphate
What is the structural formula of sodium lauryl sulphate?
See the link below.
Does food contain sodium lauryl sulphate?
If it does it probably shouldn't. That's a detergent.
Are lauryl glucoside and sodium lauryl sulfate interchangable?
no
What does TLS Shampoo stand for?
Triethanolamine Lauryl Sulphate
What is sodium lauryl sulfoacetate?
Sodium lauryl sulfoacetate is a component of some cosmetics (as a surfactant agent).
Does Colgate Oxygen toothpaste or Darlie Tea Care toothpaste or Oral B mouthwash contain sodium lauryl sulphate?
Colgate does. Not sure about the other two
What is the common name of Sodium Laureth Ether Sulphate?
it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be
What are the ingredients of prunelax ciruelax?
Prunelax Ingredients: Sodium Starch Glycolate, Polyvinylpyrrolidone, Copolyvidone, Popadry NS Clear Coating, Collodial Silicon Dioxide, Sodium Lauryl Sulphate Dimensions: .15 pounds
How does sodium lauryl sulfate have risk and benefits for humans or the environment?
Sodium lauryl sulfate is useful for humans and is not dangerous.
