Tags Elements and Compounds

Animals & Plants Arts & Entertainment Auto Beauty & Health Books and Literature Business Electronics Engineering & Technology Food & Drink History Hobbies Jobs & Education Law & Government Math People & Society Science Social Studies Sports Travel & Places

0

Subjects>Science>Chemistry

What is the structural formula of sodium lauryl sulphate?

Updated: 9/21/2023

Wiki User

∙ 12y ago

Best Answer

See the link below.

Wiki User

∙ 12y ago

This answer is:

Add your answer:

Earn +20 pts

Q: What is the structural formula of sodium lauryl sulphate?

Write your answer...

Submit

Still have questions?

imp

Continue Learning about Chemistry

Is sodium lauryl sulphate poisonous?

It does not have a high toxicity level. However, ingesting it will make you ill,

Chemical formula of sodium sulphate?

Anhydrous sodium sulphate is Na2SO4

What is the difference between sodium sulphate and sodium thiosulphate?

The polyatomic anions in sodium sulphate have the formula SO4-2, while the polyatomic anions in sodium thiosulphate have the formula S2O3-2.

What is the structural formula for sodium nitrite?

Structural: NaONO

Is sodium laureth sulfate an ionic or covalent compound?

The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.

Related questions

Does Dove Soap contain sodium lauryl sulphate?

no

What is a substance containing sodium lauryl sulphate?

shampoo

What does SLS means in Mercedes Benz SLS?

sodium lauryl sulphate

Does food contain sodium lauryl sulphate?

If it does it probably shouldn't. That's a detergent.

Is sodium lauryl sulphate poisonous?

It does not have a high toxicity level. However, ingesting it will make you ill,

Chemical formula of sodium sulphate?

Anhydrous sodium sulphate is Na2SO4

Formula sodium sulphate?

Na2SO4

Molecular formula of sodium sulphate?

The chemical formula of sodium sulfate is Na2SO4.

What is the difference between sodium sulphate and sodium thiosulphate?

The polyatomic anions in sodium sulphate have the formula SO4-2, while the polyatomic anions in sodium thiosulphate have the formula S2O3-2.

Chemical formula for sodium sulphate?

Na2SO4

What is the structural formula for sodium nitrite?

Structural: NaONO

Is sodium laureth sulfate an ionic or covalent compound?

The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.

Trending Questions

Why did Emma from h2o leave? Is zinc oxide safe in moisturizers? The formula for ammonia is NH3 the mass of 3 moles of ammonia would be how many grams? Anhydrous crystals were left uncovered overnight? The pH of soap is 4 or 9? Does endothermic or exothermic get colder? Why does silk or wool are burnt they smell like burning hair? Mdma chemical structure? What is the chemical name of borax? What atoms make up Na CI? How is salt the same as sand? Can sodium metal react with liquid acetone? How do you dilute hair color? Why is sulfuric acid rather than hydrochloric acid used to catalyze the dehydration of alcohols? How can you make a pie chart about the elements in the periodic table? Why are antimicrobial processes inhibited in the presence of extraneous organic matter? Dependability is a characteristic of? Is solubility a hydrogen bonding? Is beryllium classified as metal or non metal? Who was the first to invent soda?

Still have questions?

imp

Previously Viewed

What is the structural formula of sodium lauryl sulphate?

Resources

Top Categories

Product

Company

Copyright ©2024 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.