0
The food additive monosodium glutamate has a chemical formula of C5H8NO4Na. MSG is the salt of the non-essential amino acid glumatic acid.
Wiki User
∙ 9y ago
Add your answer:
Earn +20 pts
What is the chemical structure of MSG?
C5H8NNaO4 is the chemical formula for MSG
How do you find the molecular formula for MSG?
The chemical formula of MSG is C15H8NO4Na.
What is the molecular formula of MSG if molar mass is 169 grams?
The chemical formula of monosodium glutamate is C5H8NO4Na.
What is the empirical formula for MSG?
C5H8NNaO4
What is the chemical reaction of MSG?
C5H8NNaO4 • H2OMonosodium glutamate
what is the chemical formula for-monosodium glutamate?
MSG, 2-aminopentanedioic acid, is C5H8NNaO4 and has a SMILES (simplified molecular input line entry specification) of C(CC(=O)O)C(C(=O)O-)N.[Na+]. A link is provided to the Wikipedia article on MSG.
What is the formula for chemical energy?
Energy has no chemical formula as it is not a chemical.
What is the difference between salt and msg?
The difference between salt and msg is that salt is a natural occurring mineral substance and is needed by the human body. MSG is an artificial chemical that causes problems in the nervous system and brain.
What is the chemical name for formula?
chemical formula
What is the chemical formula for SnCl4?
That is the chemical formula. SnCl4 is the chemical formula for tin(IV) chloride.
What are the examples of salt and their chemical formula?
Copper sulfate, chemical formula CuSO4Sodium chloride, chemical formula NaClSodium chromate, chemical formula H2CrO4Mercury sulfide, chemical formula HgSCalcium carbonate,CaCO3
Is CO2 an example of a chemical equation or a chemical formula?
It is a chemical formula.
