0
The vortex noise decibel level of Sikorsky CH 3C helicopter is calculated in different parameters of the five rotatory blade revolutions per minute (rpm),thrust,sound pressure level (SPL),angular velocity radians per second, etc.
At 183 rpm at 13400 pound thrust it is 78 db,for 20,500 pound trust it is 82 db. Similarly at 213 rpm rotor speed at 20000 pound thrust the noise level is 83 db.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
What is a balanced chemical equation for propylethanoate?
The word eq'n is Ethanoic acid + propanol = propylethanoate + water. The chemical equation is CH3C(=O)-OH + CH3CH2CH2OH CH3C(=O)-O-CH2CH2CH3 + H2O)
What is the condensed structural formula of hexyl acetate?
Ch3c(=o)(-o-)ch2ch2ch2ch2ch2ch3
Ionic compound name for mo(c2h3o2)?
Molybdenum ethanoate. Mo^(+) [ CH3C(=O)-O^-]
What compounds contains both ionic and covalent bonds NaNO3 CH3Cl C2H3OH NH2OH H2O2 CH3C?
NaNO3
What is the chemical equation that indicates the production of butanol from butanone?
The reaction is:CH3CH(OH)CH2CH3 = CH3C(O)CH2CH3 + H2
What is the structural formula of propyne?
The chemical formula of propyne is CH3C≡CH.
What is the expanded structure and IUPAC name for CH2C equals OCH2CH3?
Are you sure this is correct? CH3C=OCH2CH3 would make more sense.
Water heavy metal test why you are use thioacetamide as a reagent?
Thioacetamide is used to provide metal sulphides, which will produce colour for comparison of test and standard (Pb ppm). M2+ + CH3C(S)NH2 + H2O ----> MS + CH3(CO)NH2 + 2H+Where, M is metal ion, CH3C(S)NH2 is Thioacetamide, MS is Metal sulphide.
What is the chemical formula for nail varnished?
A main component is acetone [propanon, CH3C(O)CH3 ], but sometimes butyl- and pentyl esters are also involved.
Pyruvate is made of how many carbons?
It has three carbon atoms.Pyruvate is the anion of pyruvic acid: CH3C(=O)COOH , IUPAC name: 2-oxopropanoic acid
What is the name of the compound ch3c triple bond cch2ch2ch3?
Ethyne :) (...ane is a single bond, ...ene is a double bond, ...yne is a triple bond)
What is the chemical formula ketones?
Because a ketone requires there to be a carbon attached to both sides of the ketone group. Any less, and it would be an aldehyde.
