0
CH-ch-ch-ch-ch-ch-naoh--------------->ch3-oh
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
What is rection of 1-chlorobutane with sodium ethoxide?
Cl-CH3_CH2_CH2_CH3+C2H5oNa_> C6H15o+
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the symbol equation for sodium and bromine?
Sodium + Bromine ----> Sodium bromide2 Na + Br2 ----> 2 NaBr
What is the word equation for sodium hydroxide?
Sodium Hydroxide + Hydrocloric acid --> Sodiumchloride + Water
Predict the two most likely mechanisms which occur when 2-iodohexane is heated in ethanol?
SN2 and SN1
What is rection of 1-chlorobutane with sodium ethoxide?
Cl-CH3_CH2_CH2_CH3+C2H5oNa_> C6H15o+
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the symbol equation for sodium and bromine?
Sodium + Bromine ----> Sodium bromide2 Na + Br2 ----> 2 NaBr
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the balanced equation for sodium bromide from sodiumand bromine?
This equation is 2 Na + Br2 -> 2 NaBr.
What is the equatuion of sodium oxide?
The formula [not equation!] of sodium oxide is Na2O. A possible equation for forming it is 4 Na + O2 -> 2 Na2O.
Why does the reaction of 2 2-dimethyloxirane with sodium methoxide in methanol gives primarily 1-methoxy-2-methyl-2-propanol?
Methoxide is your nucleophile; it will attack the C3 of 2,2-dimethyloxirane (the carbon that is attached to the oxygen, but doesn't have any methyl groups) via backside attack. This will cause the bond between C3 and the oxygen to break, thus releasing the chain and forming the oxide form of 1-methoxy-2-methyl-2-propanol. Since the oxide of this product is more basic than methanol, it will rip the hydrogen off of methanol, which will create the final product and regenerate methoxide.
What is the word equation for sodium hydroxide?
Sodium Hydroxide + Hydrocloric acid --> Sodiumchloride + Water
What is a balanced equation for decomposition of sodium hydrogen carbonate?
The chemical equation is:2 NaHCO3---------------------Na2O + 2 CO2 + H2O
Predict the two most likely mechanisms which occur when 2-iodohexane is heated in ethanol?
SN2 and SN1
Equation in the reactions of benzyl alcohol and sodium metal?
2 Benzyl alcohol + 2 Na ---> H2(g) + 2 sodium benzoate
What is the equation for sodium nitrate and copper III iodide?
the equation for sodium nitrate and copper III iodide can be given below.Cu I 2 +2 Na No3 ->I (NO3)2 + 2NaI. this is the balance reaction for the above.
