0
Chloramphenicol is one of the broad spectrum antibiotic used to treat typhoid fever. Resistance occur by way of mutation in ribosomes, By way of decreased permeability of cell wall and production of inactivating enzyme.
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
How can bacterial populations develop drug resistance and share that resistance with other bacteria?
resistance mechanisms often carried by plasmids can be easily transmitted in bacterial populations by conjugation
What is chioromphinacol?
Chloramphenicol is an antibiotic, inhibits the synthesis of proteins in bacteria. Aparently Chloramphenicol interfer during the transfer of amino acids from RNA-bound amino acids to Ribosome
Why chloramphenicol causes gray baby syndrome?
Chloramphenicol is metabolized by the liver. A baby's liver is not mature enough to metabolize this drug. Therefore the levels of Chloramphenicol increase in the baby's body, as there is no way for the baby to get rid of the drug. This causes cardiovascular collapse (severe hypotension), cyanosis, flaccidity, and vomiting.
What is the chemical composition of Chloroamphenicol suspforulation?
Chloramphenicol is a complicated molecule with the SMILES formula c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]. If you don't read SMILES, that's probably not especially helpful."suspforulation" isn't a real word; I suspect it refers to the formulation and just means that the chloramphenicol is in a water suspension.
The provision of mechanisms for process synchronization?
The provision of mechanisms for process synchronization
What type of antimicrobial agent is chloramphenicol?
Chloramphenicol
What does 'mechanisms of microbial drug resistance' mean?
exactly what it says. it is a mechanism that confers drug resistance to microbes. exactly what it says. it is a mechanism that confers drug resistance to microbes.
How can bacterial populations develop drug resistance and share that resistance with other bacteria?
resistance mechanisms often carried by plasmids can be easily transmitted in bacterial populations by conjugation
What are the five general mechanisms of resistance as identified by David W?
The five general mechanisms of resistance identified by David W. in the context of psychotherapy are denial, regression, acting out, transference, and projection. These mechanisms are common ways individuals may unconsciously defend against uncomfortable thoughts, feelings, or experiences in therapy.
What do you mean by non genetic resistance and how it is acquired?
Tolerance is acquired by compensatory mechanisms in the endocrine and nervous systems.
What has the author Stephen Michael Kane written?
Stephen Michael Kane has written: 'The clinical pharmacokinetics of chloramphenicol and chloramphenicol succinate'
Is chloramphenicol an aminoglycoside?
No, it is a class apart.
What is centimeters antibiotics?
Cm is an abbreviation for chloramphenicol
Why bacterial cell are sensitive to streptomycin and chloramphenicol antibiotic?
The bacterial cells are sensitive to streptomycin and chloramphenicol antibiotic because it eliminates or reduces their binding to the cells.
What reading material is available on drug resistance in melanoma?
Rockmann, H., and D. Schadendorf. "Drug Resistance in Human Melanoma: Mechanisms and Therapeutic Opportunities" Onkologie 26 (December 2003): 581-587.
What liquid antibiotic starts with ch?
CHLORAMPHENICOL OR CHLOROMYCETIN
What is chioromphinacol?
Chloramphenicol is an antibiotic, inhibits the synthesis of proteins in bacteria. Aparently Chloramphenicol interfer during the transfer of amino acids from RNA-bound amino acids to Ribosome
