0
C means Carbon and H means Hydrogen so it is possibly Hydrocarbon.
It is actually carbogen according to wikipedia
Wiki User
∙ 8y ago
Wiki User
∙ 7y agoCH2 means methylene and is a chemical compound with two double bonds.
Wiki User
∙ 7y agoCH2 is called methylene. It looks likes this
:CH2 with one lone pair of electrons on the carbon atom. It DOES NOT have two double bonds.
Wiki User
∙ 12y agoCH3 is the methyl group.
Add your answer:
Earn +20 pts
What is the chemical formula for ethyl alcohol?
C2h5-oh
What is the name for ch3---o---c6h5 ch3---ch2---ch2---o---ch2---ch3?
Old names are: Methyl Phenyl Ether and Propyl Ethyl etherOfficial names are: Methoxybenzene and ethoxy-1-propane
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What type of reaction between chlorine and butane?
This reaction is of a substitution type by a 'alkyl-radical' mechanism:Cl2 + CH3-CH2-CH2-CH3 --> CH2Cl-CH2-CH2-CH3 + HClor (a bit more in favor)Cl2 + CH3-CH2-CH2-CH3 --> CH3-CHCl-CH2-CH3 + HCl
The equation for the reaction between 2-pentene and bromine?
CH3-CH=CH-CH2-CH3 + Br2 = CH3-CH(Br)-CH(Br)-CH2-CH3
What is the chemical equation CH3?
CH3 is not a chemical equation, it is a chemical formula. CH3 is a methyl but, it can not be on its own.
What is the chemical name for CH3 CH3?
CH3 is 1 atom carbon-dioxide(carbon for short) to 3 atoms of helium. But it's not methane - methane is CH4.
What is the chemical name for isopropyl alcohol?
Ch3ch(oh)ch3
What is CH3?
Hi, CH3 is chemical formula of methyl group.
What is the chemical formula of rubbing alcohol ispropyl?
Ch3-choh-ch3
What is the chemical symbol for propane gas?
The chemical symbol for the Hydrocarbon Propane is C3H8.
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
How will convert methanol into ethanoic acid.write chemical equation?
By hydrogenation ( CH3-CH3+H2=>CH3COOH)
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
What is the chemical formula for methylbutane?
The chemical formula of methylbutane is C4H9-CH3.
