0
What else can I help you with?
What is the name for ch3---o---c6h5 ch3---ch2---ch2---o---ch2---ch3?
Old names are: Methyl Phenyl Ether and Propyl Ethyl etherOfficial names are: Methoxybenzene and ethoxy-1-propane
What is the balance equation for the addition of sodium bisulfate to acetone?
CH3 - C - CH3 + NaHSO3 ------> CH3 - C -OH
What is the chemical formula for ethyl alcohol?
The chemical formula for ethyl alcohol is C2H5OH.
What is made from Potassium Oxygen CH2 and CH3?
Potassium oxide (K2O) is made from the combination of potassium with oxygen. There is no specific chemical compound made from potassium, oxygen, CH2, and CH3.
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the chemical name for CH3 CH3?
CH3 is 1 atom carbon-dioxide(carbon for short) to 3 atoms of helium. But it's not methane - methane is CH4.
What is the chemical equation CH3?
CH3 is not a chemical equation, it is a chemical formula. CH3 is a methyl but, it can not be on its own.
What is the iupac name for ch3 ch2 ch3?
The IUPAC name for CH3CH2CH3 is propane. It is a three-carbon alkane with the chemical formula C3H8.
What is the name for this molecule ch3 ch2 ch3?
The molecule is called propane. It is a three-carbon alkane with the chemical formula C3H8.
What is the chemical name for isopropyl alcohol?
Ch3ch(oh)ch3
Is ch3 electron donating or withdrawing in a chemical reaction?
In a chemical reaction, CH3 is electron donating.
What is CH3?
Hi, CH3 is chemical formula of methyl group.
What is the chemical equation for isobutane?
C4H19 Structurally it can be (CH3)2-CH-CH3
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the name for ch3chch3chch3ch3?
The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
What is the chemical formula for butyric acid?
C4H8O2 , CH3-CH2-CH2-COOH Butyric acid and CH3-CH(CH3)-COOH isobutyric acid.
