0
What else can I help you with?
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What type of reaction between chlorine and butane?
This reaction is of a substitution type by a 'alkyl-radical' mechanism:Cl2 + CH3-CH2-CH2-CH3 --> CH2Cl-CH2-CH2-CH3 + HClor (a bit more in favor)Cl2 + CH3-CH2-CH2-CH3 --> CH3-CHCl-CH2-CH3 + HCl
What is the reaction equation of 2-butene with potassium permanganate?
2-butanol, CH3CH2CH(OH)CH3 + KMnO4 --------> butanone, CH3CH2COCH3 Butanol: OH | CH3-CH2-C-CH3 + KMnO4 | H Makes: Butanone: O CH3-CH2-C-CH3
Condensed structural formula for 1-butyne?
butanal is analdehyde. An oxygen atom is attached to a carbon chain by a double bond and therefre called a carbonyl group. It is found at the end of a carbon atom/chain. CH3-CH2-CH2-CH=O
The functinal group contained in the compound ch3 -ch2 -o -ch2 -ch3 is an?
It is an ether because an oxygen is bound to two carbons. Ethers can be defined as R-O-R' where R is a carbon group.
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
Iupac name of ch3 - ch2 - O - ch2 - ch3?
Ethoxyethane Ethyl = 2 carbons ethane + oxygen + ethane = ethoxyethane
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
What is the proper configuration of a straight chain isomer of hexane?
Ch3-ch2-ch2-ch2-ch2-ch3
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the condensed structure for Camphor?
there are 4 possibilities 1- CH3-CH2-C=CH one triple bond 2-CH3-C=C-CH3 one triple bond 3-CH2=CH-CH=CH2 two double bonds 4-CH2=C=CH-CH3 two double bonds
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
Decane can be broken during this process to form 1- butene and 2 - methylpentanewrite anequation using structural formulae to show this reaction?
The process mentioned involves the breaking of a C-C bond in decane to form 1-butene and 2-methylpentane. The structural formula equation is: CH3-(CH2)8-CH3 → CH2=CH-CH2-CH3 + CH3-CH(CH3)-CH2-CH2-CH3.
What is the name for CH3 2 CH CH 2 COO?
HCH3COO is the same thing as C2H4O2 and is the chemical formula for Acetic Acid.
