answersLogoWhite

0

There is no such compound

User Avatar

Wiki User

11y ago

What else can I help you with?

Related Questions

What is the structure for octane?

Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3


What is condensed formula for 2 3 3 4 tetramethylnonane?

The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.


Iupac name of ch3 - ch2 - O - ch2 - ch3?

Ethoxyethane Ethyl = 2 carbons ethane + oxygen + ethane = ethoxyethane


What is ch2 equals c-ch3-ch2-ch2-ch3?

The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br


What is the proper configuration of a straight chain isomer of hexane?

Ch3-ch2-ch2-ch2-ch2-ch3


What are the structural isomers for C6H10?

1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3


What is the IUPAC name for CH3-CH2-CH2-CH2-Br?

1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.


How do you name this molecule ch3 ch2 ch3?

CH3-CH2-CH3 is a gas Propane.


What is the condensed structure for Camphor?

there are 4 possibilities 1- CH3-CH2-C=CH one triple bond 2-CH3-C=C-CH3 one triple bond 3-CH2=CH-CH=CH2 two double bonds 4-CH2=C=CH-CH3 two double bonds


What is the reaction equation of 1-butene and water?

Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3


Decane can be broken during this process to form 1- butene and 2 - methylpentanewrite anequation using structural formulae to show this reaction?

The process mentioned involves the breaking of a C-C bond in decane to form 1-butene and 2-methylpentane. The structural formula equation is: CH3-(CH2)8-CH3 → CH2=CH-CH2-CH3 + CH3-CH(CH3)-CH2-CH2-CH3.


What is the name for CH3 2 CH CH 2 COO?

HCH3COO is the same thing as C2H4O2 and is the chemical formula for Acetic Acid.