0
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
Wiki User
∙ 11y agoWant this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the name of compound CH3 3?
2,2,3-tri-methyl-butane is the name of: (CH3)2-CH-C-(CH3)3 or reversely written: (CH3)3-C-CH-(CH3)2
Chemical reaction of 2-Butene?
2-butene is an alkene which may undergo several addition reactions as Hydrohalogenaton, Halogenation, Hydration, Catalytic hydrogenation, Hydroxylation and so many others some are as follows.. CH3-CH=CH-CH3 + HCl -----------> CH3-CH2-CHCl-CH3 CH3-CH=CH-CH3 + Cl2 ------------> CH3-CHCl-CHCl-CH3 CH3-CH=CH-CH3 + H2O ----H+---> CH3-CH2-CHOH-CH3
What is the structual formula of polypropene with three monomers?
-(-ch(ch3)-ch2-)--(-ch(ch3)-ch2-)--(-ch(ch3)-ch2-)-
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
How much isomers does c5h10 have?
yes it have two isomer CH3.CH2.CH=CH-CH3, and CH3-CH=C-CH3 ! CH3 BY ATIF JUTT
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the name for the ch3-ch-ch3?
1-pentanol
What is the name of compound CH3 3?
2,2,3-tri-methyl-butane is the name of: (CH3)2-CH-C-(CH3)3 or reversely written: (CH3)3-C-CH-(CH3)2
The equation for the reaction between 2-pentene and bromine?
CH3-CH=CH-CH2-CH3 + Br2 = CH3-CH(Br)-CH(Br)-CH2-CH3
Chemical reaction of 2-Butene?
2-butene is an alkene which may undergo several addition reactions as Hydrohalogenaton, Halogenation, Hydration, Catalytic hydrogenation, Hydroxylation and so many others some are as follows.. CH3-CH=CH-CH3 + HCl -----------> CH3-CH2-CHCl-CH3 CH3-CH=CH-CH3 + Cl2 ------------> CH3-CHCl-CHCl-CH3 CH3-CH=CH-CH3 + H2O ----H+---> CH3-CH2-CHOH-CH3
What is the structure of 2-pentanone?
CH3-CH(=O)-CH(CH3)-CH2-CH3
What is the structual formula of polypropene with three monomers?
-(-ch(ch3)-ch2-)--(-ch(ch3)-ch2-)--(-ch(ch3)-ch2-)-
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
How much isomers does c5h10 have?
yes it have two isomer CH3.CH2.CH=CH-CH3, and CH3-CH=C-CH3 ! CH3 BY ATIF JUTT
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
3 methyl 4 chloro hexane?
CH3-CH2-CH(CH3)-CH(Cl)-CH2-CH3
Explain Why a reaction is exothermic or endothermic because of bond energies?
the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH
