0
What else can I help you with?
What is Copper II acetate plus sodium sulfide yeilds cooper II sulfide plus sodium acetate?
When copper II acetate reacts with sodium sulfide, they undergo a double displacement reaction where the cations and anions switch partners. This results in the formation of copper II sulfide and sodium acetate as the products. Balanced chemical equation for this reaction is Cu(CH3COO)2 + Na2S —> CuS + 2CH3COONa.
What would the reaction of barium nitrate and sodium sulfide be?
The reaction of barium nitrate (Ba(NO3)2) and sodium sulfide (Na2S) would result in the formation of barium sulfide (BaS) and sodium nitrate (NaNO3). This is a double displacement reaction where the cations and anions switch partners.
What is the word equation for carbon dioxide water and sodium acetate?
The word equation for the reaction involving carbon dioxide, water, and sodium acetate is: carbon dioxide + water + sodium acetate → sodium bicarbonate.
What is the dissociation equation sodium acetate?
The dissociation equation for sodium acetate (NaCH3COO) in water would be: NaCH3COO (s) -> Na+ (aq) + CH3COO- (aq)
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is Copper II acetate plus sodium sulfide yeilds cooper II sulfide plus sodium acetate?
When copper II acetate reacts with sodium sulfide, they undergo a double displacement reaction where the cations and anions switch partners. This results in the formation of copper II sulfide and sodium acetate as the products. Balanced chemical equation for this reaction is Cu(CH3COO)2 + Na2S —> CuS + 2CH3COONa.
What is the net ionic equation of sodium acetate and barium hydroxide?
The net ionic equation for the reaction between sodium acetate (NaCH₃COO) and barium hydroxide (Ba(OH)₂) is: CH₃COO⁻(aq) + Ba²⁺(aq) → Ba(CH₃COO)₂(s) Sodium ions and hydroxide ions do not participate in the formation of the precipitation of barium acetate, so they are not included in the net ionic equation.
What would the reaction of barium nitrate and sodium sulfide be?
The reaction of barium nitrate (Ba(NO3)2) and sodium sulfide (Na2S) would result in the formation of barium sulfide (BaS) and sodium nitrate (NaNO3). This is a double displacement reaction where the cations and anions switch partners.
What is the product when one barium aatom combines with two sodium atoms?
BaS2 Barium sulfide.
What is the equation for sodium acetate?
C2H3NaOO
What is the balanced equation between sodium phosphate and barium acetate?
2Na3(po4)(aq) +3Ba(C2H3O2)2(AQ)=Ba3(Po4)2(s) + 6NaO2C2H3(aq)
Will there be a gelatenous precipitate in the reaction of barium acetate and sodium carbonate?
Yes, there will be a gelatinous white precipitate of barium carbonate formed when barium acetate and sodium carbonate are mixed together in aqueous solution. This is due to the precipitation reaction that forms an insoluble salt, barium carbonate.
What is the word equation for carbon dioxide water and sodium acetate?
The word equation for the reaction involving carbon dioxide, water, and sodium acetate is: carbon dioxide + water + sodium acetate → sodium bicarbonate.
What is the dissociation equation sodium acetate?
The dissociation equation for sodium acetate (NaCH3COO) in water would be: NaCH3COO (s) -> Na+ (aq) + CH3COO- (aq)
What is the word equation for BaCl2 Na2SO4?
barium chloride plus sodium sulphate yields barium sulphate plus sodium chloride
What is name of na2s2o3 in chemistry?
NaS2 is an unbalanced equation. It would need to be Na2S to be a balanced equation (two sodium, one sulfide). Na2S is Sodium Sulfide.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
