0
What is the net ionic equation of sodium acetate and barium sulfide?
Wiki User
∙ 7y agoWant this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What would the reaction of barium nitrate and sodium sulfide be?
Double Displacement?
What is the balanced molecular equation for Barium bromate and sodium phosphate to form barium phosphate and sodium bromate?
3Ba(BrO3)2 + 2Na3PO4 -> Ba3(PO4)2 + 6NaBrO3
What is the chemical name for Na2S?
It is a Ionic bond between Sodium Ions and Sulfide Ions. The formula name is Sodium Sulfide.Na = sodiumS = sulfurSodium Sulfide?
What is the balanced equation for sodium sulfate plus barium chloride yields barium sulfate and sodium chloride?
The balanced equation for sodium sulfate (Na2SO4) plus barium chloride (BaCl2) yielding barium sulfate (BaSO4) and sodium chloride (NaCl) is: Na2SO4 + BaCl2 -> BaSO4 + 2NaCl
What is the net ionic equation of sodium acetate and barium hydroxide?
All elements are disassociated so there is no net Ionic equation
Will there be a gelatenous precipitate in the reaction of barium acetate and sodium carbonate?
Yes, there will be a precipitate, which is barium carbonate.
What is the product when one barium aatom combines with two sodium atoms?
BaS2 Barium sulfide.
What is the equation for sodium acetate?
C2H3NaOO
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What would the reaction of barium nitrate and sodium sulfide be?
Double Displacement?
What is the word equation for BaCl2 Na2SO4?
barium chloride plus sodium sulphate yields barium sulphate plus sodium chloride
What is the balanced equation between sodium phosphate and barium acetate?
2Na3(po4)(aq) +3Ba(C2H3O2)2(AQ)=Ba3(Po4)2(s) + 6NaO2C2H3(aq)
What is name of na2s2o3 in chemistry?
NaS2 is an unbalanced equation. It would need to be Na2S to be a balanced equation (two sodium, one sulfide). Na2S is Sodium Sulfide.
Net ionic equation for sodium acetate and potassium nitrate?
sodium acetate = Na+C2H3O2- (a salt) nitric acid = HNO3 equation: NaC2H3O2 + HNO3 --> NaNO3 + C2H4O2
What are some common items that sodium is in?
Examples: sodium chloride, sodium carbonate, sodium hydrogen carbonate, sodium hydroxide, sodium sulfide, sodium acetate, sodium bromide, borax, etc.
What is the formula for barium chloride and sodium chromate?
balance equation of barrium chloride to sodium chromate
