0
This should be SO4-2 ion. sulfur shows +6 in this ion.
Wiki User
∙ 8y ago
Add your answer:
Earn +20 pts
What is Oxidation numbers for SO4?
This should be SO4-2 ion. sulfur shows +6 in this ion.
What is the oxidation state of ZnSO4?
zn is equal to +2 and so4 is equal to -2. those are the oxidation numbers. dont worry its correct
What is the oxidation number of O in SO4?
Oxygen atoms are generally considered to have an oxidation number of -2 in all oxyanions such as sulfate.
What is the oxidation number of SO4?
+6: Oxygen in oxyanions is assumed to have an oxidation state of -2; there are four such oxygen atoms, for a total of -8, and the SO4 anion has a charge of -2. This means that the sulfur atom must have an oxidation state of +6, because +6 added to - 8 = -2.
What is the oxidation number for Al2O3?
+3 for Al and -2 for O is the oxidation number for Al2O3.
What is Oxidation numbers for SO4?
This should be SO4-2 ion. sulfur shows +6 in this ion.
What is the oxidation state of ZnSO4?
zn is equal to +2 and so4 is equal to -2. those are the oxidation numbers. dont worry its correct
What is the oxidation number of O in SO4?
Oxygen atoms are generally considered to have an oxidation number of -2 in all oxyanions such as sulfate.
What is the oxidation state of each element in (SO4)2-?
SO4^2- has a net negative 2 charge.each O = 2-S = 6+
What is the oxidation number of SO4?
+6: Oxygen in oxyanions is assumed to have an oxidation state of -2; there are four such oxygen atoms, for a total of -8, and the SO4 anion has a charge of -2. This means that the sulfur atom must have an oxidation state of +6, because +6 added to - 8 = -2.
Balance an equation by oxidation method?
k2cr2o7+FeSO4+H2SO4 --> Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O
What is the oxidation number for Al2O3?
+3 for Al and -2 for O is the oxidation number for Al2O3.
What is the oxidation number of Cr in Cr2(SO4)3?
Chromium is a useful element. It shows +2 in this compound.
What is the oxidation numbers in PO34?
The oxidation numbers in PO43- , phosphorus oxidation number=+5; oxygen = -2
What is the sum of the oxidation numbers for P2O5?
There are two oxidation numbers. P shows +5 oxidation number.
What is THE common oxidation number for tantalum?
It shows some oxidation numbers. Generally it shows +4 oxidation numbers.
WHAT IS THE OXIDATION NUMBER OF AL2(SO4)3?
Aluminium is a light metal. Al shows +3 in aluminium sulfate.
