0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
How is dry ice formed when sodium acetate is added to water?
Dry ice is not formed in this instance.Dry ice is solid carbon dioxide. The phenomenon involving sodium acetate is colloquially called hot ice. Simply adding sodium acetate to water will not produce this. You need to create a supersaturated solution. You add sodium acetate to water untill it cannot dissolve any more, and then cool the solution. Now you have an unstable solution that has more dissolved sodium acetate than it could normally hold. If it is disturbed, the sodium acetate will sponaneously crystallize.
What is the trihydrate in sodium acetate as trihydrate crystals?
The term trihydrate refers to the fact that three molecules of water are associated with each formula unit of sodium acetate. The formula unit for sodium acetate trihydrate is NaC2H3O2‧3H2O.
What happens when sodium hydroxide is added to acetic acid?
sodium acetate and water are formed.
Why distilled water is used to make sodium extract?
because sodium metal immediately react with water and causes explosion thats why we use distilled water in preparing sodium extract by asghar tariq nohri
Is sodium acetate soluble or insoluble in water?
Sodium acetate is soluble in water.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
Is sodium acetate soluble in water?
yes
What do vinegar and baking soda create?
Carbon Dioxide, Water, and Sodium Acetate Sodium bicarbonate + acetic acid ---> sodium acetate + carbon dioxide + water (baking soda) (vinegar)
How is dry ice formed when sodium acetate is added to water?
Dry ice is not formed in this instance.Dry ice is solid carbon dioxide. The phenomenon involving sodium acetate is colloquially called hot ice. Simply adding sodium acetate to water will not produce this. You need to create a supersaturated solution. You add sodium acetate to water untill it cannot dissolve any more, and then cool the solution. Now you have an unstable solution that has more dissolved sodium acetate than it could normally hold. If it is disturbed, the sodium acetate will sponaneously crystallize.
Is sodium chloride a strong electrolyte when distilled in water?
Yes, when is dissolved (not distilled) in water or when is melted.
Is CuCO3 soluble in water?
Yes, NaCH3COO (sodium acetate) is soluble in water as are all sodium compounds.
What is the trihydrate in sodium acetate as trihydrate crystals?
The term trihydrate refers to the fact that three molecules of water are associated with each formula unit of sodium acetate. The formula unit for sodium acetate trihydrate is NaC2H3O2‧3H2O.
What happens when sodium hydroxide is added to acetic acid?
sodium acetate and water are formed.
Why distilled water is used to make sodium extract?
because sodium metal immediately react with water and causes explosion thats why we use distilled water in preparing sodium extract by asghar tariq nohri
When sodium chloride and distilled water solution is evaporated what is left?
Sodium Chloride
After mixing baking soda and vinegar we produce sodium acetate plus water plus carbon dioxide What state of matter is the sodium acetate at this point?
solid
