0
Covalent single- and double-bonds.
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
Why do saturated fatty acid have straight structures while unsaturated fatty acid structure bend?
The bent structure in unsaturated fatty acids arises due to the presence of the double bonds.
What is a distinguishing characteristic of a saturated fatty acid-?
Saturated fatty acids do not have double bonds between carbon atoms and unsaturated.
Write the structure of linolenic acid why is it an unsaturated fatty acid?
ch3ch2ch=chch2ch=chch2ch=ch(ch2)6cooh It's an unsaturated fatty acids because it has double bonds
Fatty acids containing at least one double or triple covalent bond is called?
These fatty acids are called saturated fats. These are often some of the worst fats for the body.
What kind of bonding is necessary to produce a saturated fatty-acid?
Unlike unsaturated fatty acids, which contain double carbon bonds, saturated fatty acids have enough hydrogen bonded to their carbon atoms so that they can only have single bonds.
What are unsaturated fatty acids?
Unsaturated fatty acids are fatty acids that have double bonds in their long carbon chains.
What is the difference between a saturated an a unsaturated fatty acid?
Unsaturated fatty acids have double bond or triple bonds, whereas saturated fatty acids do not.
What causes an unsaturated fatty acid to have differ t shape than a satires fatty acid?
Unsaturated fatty acids have double carbon bonds.
Are fatty acids with double bonds saturated or not?
Fatty acids containing double bonds are unsaturated fatty acids as they still contain sp2 carbon atoms within them.
Fatty acids with double bonds between carbons are described to be?
Fatty acids with double bonds between some of their carbons are referred to as unsaturated fatty acids. These fatty acids tend be remain in liquid form at room temperature.
Why do saturated fatty acids have structures while unsaturated fatty acids have bent structures?
Because unsaturated fatty acids have many double bonds and the atoms cannot rotate freely around those double bonds. In the saturated fatty acids, there are no double bonds (only single bonds) and so the atoms are free to rotate.
Distinguish between saturated fatty acids and saturated fatty acids?
There is no difference between saturated fatty acids and saturated fatty acids. If you meant saturated fatty acids and UNsaturated fatty acids, then the unsaturated ones are the ones with double (or, theoretically, triple) bonds in the carbon chain.
What causes an unsaturated fatty to have a different shape than a saturated fatty acid?
unsaturated fatty acids have a double carbon bonds APEX
What causes an unsaturated fatty acid to have a different shape than an a saturated fatty acid?
Unsaturated fatty acids have double carbon bonds.
What is a distinguished characteristic of a saturated fatty acids?
Saturated fatty acids do not have double bonds between carbon atoms and unsaturated.
Why do saturated fatty acids have straight structures while unsaturated fatty acids acids bent structures?
Saturated fatty acids have single carbon-to-carbon bonds (which tend to act like a rigid pole) while unsaturated fatty acids have double carbon-to-carbon bonds (which can act like hinges making the molecule flexible).
Fats composed of fatty acids that have double bonds in the fatty acids and have fewer than the maximim number of hydrogen atoms are?
unsaturated
