0
When this equation is balanced what is the coefficient for Ni NO3 3?
Wiki User
∙ 9y ago
The coefficient for Ni NO3 3 is four.
Wiki User
∙ 9y ago
Add your answer:
Earn +20 pts
Gold III nitrate?
Nickel Iodite is NiIO2. This salt is hypothetical noiodite salts have been isolated.Chlorites are known and a bromite.
What is the balance equation for NaCl plus BaCl2?
This equation does not balance because 2 chlorine salts do not react with eachother. However, they are both highly soluable in water. By adding H2O, this equation can be balanced.
What is the chemical formula for nickel3 oxalate?
The formula of Nickel(III) Oxalate is Ni2(C2O4)3.
What is made when silver nitrate react with calcium chloride?
silver nitrate (AgNO3) is an ionic compound and so does calcium chloride (CaCl2). Two ionic compounds react to produce two salts. This is called changing ions because Ag receives Cl now instead of NO3 and Ca receives NO3. Therefore, AgNO3 + CaCl2 = AgCl + Ca(NO3)2. A rule is present that Nitrate is soluble (it dissolves in H2O). Meanwhile, both, Cl and Ag are insoluble, therefore a solid we call as precipitate will settle to the bottom. this precipitate is AgCl (solid). All in all this reaction is called the precipitation reaction.
What is the chemical formula for nickel (iii) sulfate?
Ni+2 SO4-2 <--- These are the ions and their charges. The charges have to have a net charge of zero, so one +2 nickel ion cancels out one -2 sulfate ion. The final formula would then be NiSO4
When this equation is balanced what is the coefficient for ni (no.3) 3?
The coefficient for Ni NO3 3 is four.
When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?
Your formulas are not correct.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the coefficient for Ni No3 3?
4
What is the coefficient for ni (no3)4?
4
When balancing equations should you adjust the subscripts or the coefficients?
Subscripts state how many atoms and Coefficients state how many molecules there are. So when balancing an equation you always adjust the coefficients. When this equation is balanced, what is the coefficient for Ni(NOËÄ)ËÄ? 4
What is the chemical equation for magnesium metal and nickel nitrate?
Magnesium is not polyvalent so you do not need to specify Magnesium 2 or II.The formula for magnesium nitrate is Mg(NO3)2If you had intended to ask the formula for manganese (II) nitrate, it is Mn(NO3)2
What is the formula for nickel I nitrite?
Ni+1 NO2-1
What is the balanced chemical equation for nickel ii sulphate and disodium salt of edta?
NiSO4 + Na2(edta) -----> Ni(edta) + Na2SO4
Sodium carbonate plus nickel nitrate?
The chemical equation is:Na2CO3 + Ni(NO3)2 = 2 NaNO3 + NiCO3(s)
What is the formula for nickelII nitrate?
Formula: Ni(NO3)2
What is the formula of Nickel Nitrate?
Formula: Ni(NO3)2
