answersLogoWhite

0

on the A51

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

What 2 4?

CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane


What’s 2×4?

CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane


What is the correct structure of 3-ethyl-3-methylhexane?

The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3


What is the name for the CH3-Ch-CH3 alkyl group?

The name for the CH3-Ch-CH3 alkyl group is isopropyl.


What is the extended structural formula of 2-methyl propane?

Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3


How do you name this molecule ch3 ch2 ch3?

CH3-CH2-CH3 is a gas Propane.


Can you make two structural isomers from a saturated alkane C4H10?

n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3


what is the formula for "2-bromo-2-methylpropane + H2O →2-methylpropan-2-ol + HBr"?

CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr


What is condensed formula for 2 3 3 4 tetramethylnonane?

The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.


What is the structure of 2-pentanone?

CH3-CH(=O)-CH(CH3)-CH2-CH3


Cite examples of chemicals that contains carbon-carbon bonds?

ethane CH3-CH3 propane CH3-CH2-CH3 butane CH3-CH2-CH2-CH3 (all the above are alkanes, their are a lot of other types of hydrocarbons and carbon-carbon bonds)


What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?

The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O