0
Why do we add H2So4 H3PO4 and di phenyl amine in the titration between k2Cr2O7 and mohr salt?
Wiki User
∙ 11y agoWant this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
Balance an equation by oxidation method?
k2cr2o7+FeSO4+H2SO4 --> Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O
Why is that when NaOH H2SO4 and phenophtalein in conical flask becomes hot after shaking during titration?
The reaction between NaOH and H2SO4 is highly exothermic, meaning it releases heat. When the solutions are mixed in the conical flask and shaken during titration, this reaction occurs and produces a significant amount of heat. Additionally, the presence of phenolphthalein might contribute to the sensation of heat as it can change color when exposed to heat or pH changes, indicating the progress of the reaction.
What are the products formed from a reaction between hydrogen iodide and sulfuric acid?
HI + H2SO4 = HIO- + H2SO3-
Is h2so4 a base acid or salt?
H2SO4 is a highly concentrated acid.
How do you write the balanced equation between an acid and a base?
An example is:2 KOH + H2SO4 = K2SO4 + 2 H2O
Which indicator is used in titration of naoh and h2so4?
Methyl orange
A 25.00ml sample of h2so4 requires 22.65 ml of the 0.550m naoh for its titration what was the concentration of sulfuric acid?
(25.00ml H2SO4)(H2SO4 M) = (22.65ml NaOH)(0.550M) = 0.4983M H2SO4
Why H2SO4 is added in K2Cr2O7 during oxidation of alcohol?
K2Cr2O7+4H2SO4= K2SO4+Cr2(SO4)3+4H2O+3[O] As you can see during this reaction you obtain the O that you need for the oxidation of alcohol.
Equation between potassium dichromate and iron sulfate?
6 FeSO4 + K2Cr2O7 + 7 H2SO4 = 3 Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + 7 H2O
What is the colour change in the titration of KOH with H2SO4 using methyl orange as the indicator?
orange
What color will the solution be if you add H2SO4 to the K2CrO4 solution?
K2Cr2O7 + 6 KI + 7 H2So4 = Cr2(So4)3 + 4 K2So4 + 3 I2 + 7 H2O
How do you convert acetylene to acetone?
C2H2 or (HCtriplebond CH) --20%H2SO4,HGSO4,60 to 80 dgree--> CH3CHO --k2Cr2O7/conc. H2SO4 [O]--> CH3COOH --Ca(OH)2--> (CH3COO)2Ca --Dry distillation-->CH3COCH3
How do you balance k2cr2o7 h2so4 c2h5oh -- cr2so43 k2so4 ch3cooh h2o?
2K2Cr2O7+ 8H2SO4+ 3C2H5OH --> 2Cr2(SO4)3+ 2K2SO4 + 3CH3COOH + 11H2O
What is formed in the titration of FeCl2 with KMnO4 with H2SO4 present?
FeCl2 + 2KMnO4 --> Fe(MnO4)2 + 2KCl
Balance an equation by oxidation method?
k2cr2o7+FeSO4+H2SO4 --> Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O
Product of potassium dicromate reacting with sulfur dioxide?
K2Cr2O7(aq) + 3SO2(g) + H2SO4(aq) Cr2(SO4)3(aq) + K2SO4(aq) + H2O(l)
What are the coefficients in K2Cr2O7 H2SO4 C2H5OH --- Cr2SO43 K2SO4 CH3COOH H2O?
2K2Cr2O7 + 2H2SO4 + 3C2H5OH ---> 2Cr2(SO4)3 + 2K2SO4 + 3CH3COOH + 11H2O.
