0
What else can I help you with?
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the nomenclature for ch3 ch2 ch2 ch2 ch2 ch2 ch2 ch3?
The nomenclature for CH3CH2CH2CH2CH2CH2CH2CH3 is octane. It is an alkane with 8 carbon atoms in a straight chain.
What is 1-3-dichloro-3-methylheptane in a condensed structural formula?
CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
What is the proper configuration of a straight chain isomer of hexane?
Ch3-ch2-ch2-ch2-ch2-ch3
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is the IUPAC name for CH3-CH2-CH2-CH2-Br?
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
Decane can be broken during this process to form 1- butene and 2 - methylpentanewrite anequation using structural formulae to show this reaction?
The process mentioned involves the breaking of a C-C bond in decane to form 1-butene and 2-methylpentane. The structural formula equation is: CH3-(CH2)8-CH3 → CH2=CH-CH2-CH3 + CH3-CH(CH3)-CH2-CH2-CH3.
What is the of 4 4?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
What is thiol?
CH3-CH2-CH2-CH2-SH
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
