0
Ch3co2h + ch3(ch2)7oh ---- ch3coo(ch2)7ch3 + h2o
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
What ester is formed when acetic acid reacts with octyl alcohol?
It forms Octyl Acetate.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
Ester formed between 1-octanol and glacial acetic acid?
Octyl Acetate
What is the chemical equation of aluminum iodide and leadII acetate?
It is aprecipitate chemical reaction.The chemical equation of aluminum iodide and leadII acetate is given as follows.. 2AlI3(aq) + 3Pb(C2H3O2)2(aq) --> 3PbI2(s) + 2Al(C2H3O2)3(aq).The above is a balanced equation.
What is the Chemical equation for acetic acid and lithium hydroxide produce water and lithium acetate?
LiC2H3O2 + H2O
What ester is formed when acetic acid reacts with octyl alcohol?
It forms Octyl Acetate.
What does octyl acetate smell like?
bananas
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
Ester formed between 1-octanol and glacial acetic acid?
Octyl Acetate
What is the chemical equation of aluminum iodide and leadII acetate?
It is aprecipitate chemical reaction.The chemical equation of aluminum iodide and leadII acetate is given as follows.. 2AlI3(aq) + 3Pb(C2H3O2)2(aq) --> 3PbI2(s) + 2Al(C2H3O2)3(aq).The above is a balanced equation.
What is the Chemical equation for acetic acid and lithium hydroxide produce water and lithium acetate?
LiC2H3O2 + H2O
Show 100 equation of converting word equation into chemical equation?
One example would be: acetic acid and ammonia form ammonium acetate. CH3COOH + NH3 --------> CH3COONH4
What is the molecular structure of orange oil?
its an octyl acetate, that is an ester in which an 8 carbon strand is conected to the o and a methyl attached to the carbonyl.
Lead ii acetate and copper ii sulfate balanced equation?
The chemical equation is:CuSO4 + Pb(CH3COO0)2 = Cu(CH3COO)2 + PbSO4(s)
Orange tastes like?
Oranges taste and smell like Octyl acetate, or octyl ethanoate. It is an organic compound with the formula CH3(CH2)7O2CCH3. It is an ester as are most fruity odours . The smell of an orange is similar to Limonene (a cyclic terpene).
What is the chemical equation for sodium acetate with water amd acetic acid?
Any chemical reaction; a solution is obtained, containing ions as Na+ and the carboxy group -COOH.
What is the chemical name for CH3COO2?
This chemical formula is for beryllium acetate.
