0
What else can I help you with?
What ester is formed when acetic acid reacts with octyl alcohol?
Ethanoic (Acetic) Acid + Octanol(Octyl alcohol) = Octyl Ethanoate ( Octyl Acetate). and water . Here is the BALANCED reaction eq'n. CH3COOH + CH3(CH2)6CH2OH CH3(CH2)6CH2OOCCH3 + H2O
Ester formed between 1-octanol and glacial acetic acid?
The ester formed between 1-octanol and glacial acetic acid is octyl acetate. This reaction involves the condensation of the hydroxyl group of 1-octanol with the carboxyl group of acetic acid, resulting in the formation of the ester bond. Octyl acetate is commonly used as a flavor and fragrance ingredient due to its fruity aroma.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the chemical equation of aluminum iodide and leadII acetate?
It is aprecipitate chemical reaction.The chemical equation of aluminum iodide and leadII acetate is given as follows.. 2AlI3(aq) + 3Pb(C2H3O2)2(aq) --> 3PbI2(s) + 2Al(C2H3O2)3(aq).The above is a balanced equation.
What is the equation for mercury acetate?
The chemical formula for mercury(II) acetate is Hg(CH3COO)2. It consists of one mercury (Hg) atom bonded to two acetate (CH3COO) groups.
What ester is formed when acetic acid reacts with octyl alcohol?
Ethanoic (Acetic) Acid + Octanol(Octyl alcohol) = Octyl Ethanoate ( Octyl Acetate). and water . Here is the BALANCED reaction eq'n. CH3COOH + CH3(CH2)6CH2OH CH3(CH2)6CH2OOCCH3 + H2O
What does octyl acetate smell like?
Octyl acetate has a fruity and sweet aroma, often described as similar to oranges or apricots. It is commonly used as a flavoring agent in foods and beverages due to its pleasant scent.
Ester formed between 1-octanol and glacial acetic acid?
The ester formed between 1-octanol and glacial acetic acid is octyl acetate. This reaction involves the condensation of the hydroxyl group of 1-octanol with the carboxyl group of acetic acid, resulting in the formation of the ester bond. Octyl acetate is commonly used as a flavor and fragrance ingredient due to its fruity aroma.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the chemical equation of aluminum iodide and leadII acetate?
It is aprecipitate chemical reaction.The chemical equation of aluminum iodide and leadII acetate is given as follows.. 2AlI3(aq) + 3Pb(C2H3O2)2(aq) --> 3PbI2(s) + 2Al(C2H3O2)3(aq).The above is a balanced equation.
What is the equation for mercury acetate?
The chemical formula for mercury(II) acetate is Hg(CH3COO)2. It consists of one mercury (Hg) atom bonded to two acetate (CH3COO) groups.
What is Chemical equation of Lithium nitrate and lead II acetate?
The chemical equation for the reaction between lithium nitrate and lead(II) acetate is: 2LiNO3 + Pb(C2H3O2)2 → 2LiC2H3O2 + Pb(NO3)2. This reaction involves a double displacement reaction where lithium and lead ions swap partners with the nitrate and acetate ions.
What is the balanced equation of barium acetate and potassium iodide?
The balanced chemical equation for the reaction between barium acetate and potassium iodide is: Ba(CH3COO)2 + 2KI -> BaI2 + 2KCH3COO
What is the chemical equation in the preparation of potassium acetate?
The preparation equation depends on the route by which this compound is prepared. A simple route is neutralization of acetic acid with potassium hydroxide: KOH + CH3COOH --> H2O + K+CH3COO-
What is a balanced chemical equation for propylethanoate?
The word eq'n is Ethanoic acid + propanol = propylethanoate + water. The chemical equation is CH3C(=O)-OH + CH3CH2CH2OH CH3C(=O)-O-CH2CH2CH3 + H2O)
What is the Chemical equation for acetic acid and lithium hydroxide produce water and lithium acetate?
The chemical equation for acetic acid (CH3COOH) reacting with lithium hydroxide (LiOH) to produce water (H2O) and lithium acetate (LiCH3COO) can be represented as: CH3COOH + LiOH → H2O + LiCH3COO
Show 100 equation of converting word equation into chemical equation?
One example would be: acetic acid and ammonia form ammonium acetate. CH3COOH + NH3 --------> CH3COONH4
