answersLogoWhite

0

bananas

User Avatar

Wiki User

∙ 14y ago

What else can I help you with?

Continue Learning about Earth Science

What is the content of ethyl acetate in a banana?

The smell of bananas comes from the ester 3-methylbutyl acetate. Ethyl acetate has a smell similar to that of bananas and is often used in banana fragrances as well as being naturally found in some wines. The ester 3-methylbutyl acetate (isopentyl acetate) is an artificial banana scent/flavor. While we perceive the smell of this compound as the smell of bananas, the chemical is not responsible for the scent/flavor of real bananas. Banana candies (runts for example) use 3-methylbutyl acetate as the artificial flavoring and any true banana lover could tell you that the candies taste different than the fruit.


What is the odor of sodium acetate?

Each acid has its own characteristic smell. For example, Acetic Acid smells like vinegar. It is hard to generalise like that. Maybe the name of the acid would help. There are other more reliable features for identifying acids, such as, pH and taste etc.


Is megestrol acetate a steroid?

Yes, megestrol acetate is a synthetic progestin derivative, which is similar in structure to progesterone. While it is not a classical steroid like testosterone or cortisol, it does have some steroid-like effects in the body.


Is sodium chloride soluble in ethyl acetate?

No, sodium chloride is not soluble in ethyl acetate. Ethyl acetate is a nonpolar solvent, while sodium chloride is an ionic compound that is highly soluble in water but not in nonpolar solvents like ethyl acetate.


What is the name of LiC2H3O2?

lead acetate

Related Questions

Orange tastes like?

Oranges taste and smell like Octyl acetate, or octyl ethanoate. It is an organic compound with the formula CH3(CH2)7O2CCH3. It is an ester as are most fruity odours . The smell of an orange is similar to Limonene (a cyclic terpene).


What smell is produced when acetic acid combines with n-octyl alcohol?

When acetic acid combines with n-octyl alcohol, it produces the pleasant smell of octyl acetate, which has a fruity and floral aroma reminiscent of oranges or jasmine. This compound is commonly used as a fragrance in perfumes and other scented products.


What ester is formed when acetic acid reacts with octyl alcohol?

Ethanoic (Acetic) Acid + Octanol(Octyl alcohol) = Octyl Ethanoate ( Octyl Acetate). and water . Here is the BALANCED reaction eq'n. CH3COOH + CH3(CH2)6CH2OH CH3(CH2)6CH2OOCCH3 + H2O


What is the chemical equation for octyl acetate?

The chemical equation for octyl acetate is: C8H17OH + CH3COOH → C8H17OCOCH3 + H2O. This reaction involves the esterification of octanol (C8H17OH) and acetic acid (CH3COOH) to form octyl acetate (C8H17OCOCH3) and water (H2O).


Ester formed between 1-octanol and glacial acetic acid?

The ester formed between 1-octanol and glacial acetic acid is octyl acetate. This reaction involves the condensation of the hydroxyl group of 1-octanol with the carboxyl group of acetic acid, resulting in the formation of the ester bond. Octyl acetate is commonly used as a flavor and fragrance ingredient due to its fruity aroma.


What is the ester formed from acetic acid and n-pentyl alcohol?

Pentyl Ethanoate The structural formula looks like this: CH3-CH2-CH2-CH2-CH2-O-C(=O)* -CH3 *The double bonded O goes on top of the C and the last CH3 is attached to the C, not the double bonded O.


What smell is produced when acetic acid combines with n octyl alcohol?

When acetic acid combines with n-octyl alcohol, the smell produced is usually a fruity or floral scent. This combination forms esters, which are commonly used in perfumery to provide pleasant fragrances.


What combination of alcohol and acid will form octyl benzoate?

Octyl benzoate can be formed by reacting octanol (alcohol) and benzoic acid in the presence of a catalyst like sulfuric acid. The reaction will produce octyl benzoate and water as byproduct.


What is the ester formed from octyl benzoate?

The ester formed from octyl benzoate is called octyl benzoate. It is formed when octanol reacts with benzoic acid in the presence of a catalyst. This ester is commonly used in cosmetics and personal care products as a fragrance ingredient or UV filter.


What is the content of ethyl acetate in a banana?

The smell of bananas comes from the ester 3-methylbutyl acetate. Ethyl acetate has a smell similar to that of bananas and is often used in banana fragrances as well as being naturally found in some wines. The ester 3-methylbutyl acetate (isopentyl acetate) is an artificial banana scent/flavor. While we perceive the smell of this compound as the smell of bananas, the chemical is not responsible for the scent/flavor of real bananas. Banana candies (runts for example) use 3-methylbutyl acetate as the artificial flavoring and any true banana lover could tell you that the candies taste different than the fruit.


What is the Molecular structure of Hydrogen?

H2S


What is 1-octanol and acetic acid reaction?

This is an ESTERification reaction. CH3(CH2)6CH2OH + CH3COOH < ==H^+==> CH3COOCH2(CH2)6CH3 + H2O The products are Octyl ethanoate(acetate) and water. A little Sulphuric Acid (H^+) is used to speed up the relux reaction.