0
bananas
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
What is the content of ethyl acetate in a banana?
The smell of bananas comes from the ester 3-methylbutyl acetate. Ethyl acetate has a smell similar to that of bananas and is often used in banana fragrances as well as being naturally found in some wines. The ester 3-methylbutyl acetate (isopentyl acetate) is an artificial banana scent/flavor. While we perceive the smell of this compound as the smell of bananas, the chemical is not responsible for the scent/flavor of real bananas. Banana candies (runts for example) use 3-methylbutyl acetate as the artificial flavoring and any true banana lover could tell you that the candies taste different than the fruit.
What is the odor of sodium acetate?
Each acid has its own characteristic smell. For example, Acetic Acid smells like vinegar. It is hard to generalise like that. Maybe the name of the acid would help. There are other more reliable features for identifying acids, such as, pH and taste etc.
Why is lead acetate added to tea?
Lead acetate is added to plant extracts like tea and coffee, to remove the tannins.
What is the name of LiC2H3O2?
lead acetate
What is 2-butoxy ethanol acetate?
2-butoxyethanol acetate is also known as ethylene glycol monobutyl ether acetate, butoxyethyl acetate, butyl glycol acetate, ethylene glycol butyl ether acetate, acetic acid 2-butoxyethyl ester, glycol monobutyl ether acetate, butyl Cellosolve acetate, or Ektasolve EB acetate. Common abbreviations for 2-butoxyethanol acetate include BEA and EGBEA. 2-Butoxyethanol acetate can be found in air, water and soil as contaminant. It is a colorless liquid with a fruity odour. Most people can begin to smell 2-butoxyethanol acetate in air at 0.10–0.48 ppm. It is only moderately soluble in water but is soluble in most organic solvents. This means that when 2-butoxyethanol acetate and water or 2-butoxyethanol and organic solvents are mixed, the mixtures form one layer, unlike mixing oil and water which separate into two layers. 2-Butoxyethanol acetate is a fire hazard when exposed to heat, sparks, flames, or oxidizers. 2-Butoxyethanol acetate in the environment also comes from some industrial activities. It is prepared by reacting 2-butoxyethanol with acetic acid, acetic acid anhydride, or acetic acid chloride. 2-Butoxyethanol acetate is widely used as a slow-evaporating solvent for lacquers, varnishes, epoxy resins, and enamels. It is also used in polyvinyl acetate latex, and it may be used in some ink and spot remover formulations.
Orange tastes like?
Oranges taste and smell like Octyl acetate, or octyl ethanoate. It is an organic compound with the formula CH3(CH2)7O2CCH3. It is an ester as are most fruity odours . The smell of an orange is similar to Limonene (a cyclic terpene).
What ester is formed when acetic acid reacts with octyl alcohol?
It forms Octyl Acetate.
Ester formed between 1-octanol and glacial acetic acid?
Octyl Acetate
What is the chemical equation for octyl acetate?
Ch3co2h + ch3(ch2)7oh ---- ch3coo(ch2)7ch3 + h2o
What smell is produced when acetic acid combines with n octyl alcohol?
orange
What is the molecular structure of orange oil?
its an octyl acetate, that is an ester in which an 8 carbon strand is conected to the o and a methyl attached to the carbonyl.
What is the ester formed from acetic acid and n-pentyl alcohol?
Pentyl Ethanoate The structural formula looks like this: CH3-CH2-CH2-CH2-CH2-O-C(=O)* -CH3 *The double bonded O goes on top of the C and the last CH3 is attached to the C, not the double bonded O.
What smell is produced when acetic acid combines with n-octyl alcohol?
You're supposed to get an orange scent
What is the content of ethyl acetate in a banana?
The smell of bananas comes from the ester 3-methylbutyl acetate. Ethyl acetate has a smell similar to that of bananas and is often used in banana fragrances as well as being naturally found in some wines. The ester 3-methylbutyl acetate (isopentyl acetate) is an artificial banana scent/flavor. While we perceive the smell of this compound as the smell of bananas, the chemical is not responsible for the scent/flavor of real bananas. Banana candies (runts for example) use 3-methylbutyl acetate as the artificial flavoring and any true banana lover could tell you that the candies taste different than the fruit.
What is the ester formed from octyl benzoate?
the ester formed is methyl benzoate which is also known as oil of wintergreen
What combination of alcohol and acid will form octyl benzoate?
Benzoic acid and n-octyl alcohol in presence of sulphuric acid on heating form octyl benzoate and water.
What is an example of a fruity odor?
The smell of ethyl acetate is an example of fruity odour.
