answersLogoWhite

0

There would need to be a double bond between the two CH's such as in CH3CH2CH=CHCH2NH2, otherwise the molecule wouldn't exist. The name of this compound would be
2-penten-1-amine

User Avatar

Lewis Streich

Lvl 13
3y ago

What else can I help you with?

Related Questions

What are the FOUR structural isomers of C2H5N?

The structure formulas of the four isomers of C3H9N are: Propamine : CH3-CH2-CH2-NH2 : or : CH3-[CH2]2-NH2 Prop-2-amine : CH3-CH-NH2-CH3 EthyMethylamine : CH3-NH-CH2-CH3 TriMethylamine : N(CH3)3


What is the IUPAC name for CH3-CH2-CH2-CH2-Br?

1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.


What are the formulas for the 8 essential amino acids?

Valine: HO2CCH(NH2)CH(CH3)2 Tryptophan: C11H12N2O2 Threonine: HO2CCH(NH2)CH(OH)CH3 Phenylalanine: HO2CCH(NH2)CH2C6H5 Methionine: HO2CCH(NH2)CH2CH2SCH3 Lysine: HO2CCH(NH2)(CH2)4NH2 Leucine: HO2CCH(NH2)CH2CH(CH3)2 Isoleucine: HO2CCH(NH2)CH(CH3)CH2CH3


What is the name of ch3 ch2 ch2 ch3?

The name of the compound CH3CH2CH2CH3 is butane.


What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?

The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.


What is the name for ch3-ch2-ch2-ch2-ch2-nh2?

IUPAC name: 1-aminopropane Common name: n-Propylamine This is a primary amine - since the N is only bonded to one C in the CH2 group. To come up with IUPAC name, you name it as you would an alkane. This has a three carbon chain which makes it propane. You add the amino in front of propane. The 1 indicates what carbon the NH2 is bonded to. To come up with common name, you name the alkyl group, followed by the word amine. So, CH3, CH2, CH2 is propyl - add an amine at end. Propylamine is correct, but n-propylamine is more correct.


How do you name this molecule ch3 ch2 ch3?

CH3-CH2-CH3 is a gas Propane.


What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?

Cyclopentyl ethyl ester


Which class of compound is the following ch3-ch2-nh2?

The compound CH3-CH2-NH2 is classified as an amine. Specifically, it is a primary amine because the nitrogen atom is bonded to one alkyl group (ethyl group, in this case) and two hydrogen atoms. Amines are characterized by the presence of the amino group (-NH2) and can act as bases and nucleophiles in chemical reactions.


What is the name for ch3-ch2-ch2-nh2?

IUPAC name: 1-aminopropane Common name: n-Propylamine This is a primary amine - since the N is only bonded to one C in the CH2 group. To come up with IUPAC name, you name it as you would an alkane. This has a three carbon chain which makes it propane. You add the amino in front of propane. The 1 indicates what carbon the NH2 is bonded to. To come up with common name, you name the alkyl group, followed by the word amine. So, CH3, CH2, CH2 is propyl - add an amine at end. Propylamine is correct, but n-propylamine is more correct.


What is the reaction equation of 1-butene and water?

Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3


What is the structure for octane?

Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3