answersLogoWhite

0

sorry about that just go to YouTube and look up "hot ice" and click on the 1st one

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

Is sodium acetate soluble or insoluble in water?

Sodium acetate is soluble in water.


What is the role of hydration in converting solid sodium acetate to sodium acetate trihydrate?

Hydration plays a crucial role in converting solid sodium acetate to sodium acetate trihydrate by allowing water molecules to bond with the sodium acetate crystals, forming a hydrated compound with three water molecules for every molecule of sodium acetate. This process is essential for the formation of sodium acetate trihydrate, which has different properties compared to the anhydrous form of sodium acetate.


What is the word equation for carbon dioxide water and sodium acetate?

The word equation for the reaction involving carbon dioxide, water, and sodium acetate is: carbon dioxide + water + sodium acetate → sodium bicarbonate.


Is sodium acetate soluble in water?

Yes, sodium acetate is soluble in water. It forms a clear, colorless solution when added to water.


Spells to freeze water with your hand?

No, there are no spells to do such a thing. However, it is possible to create the illusion of instantly freezing water at a touch using a supersaturated solution of sodium acetate.


Is ch3coona and nach3coo the same thing?

No, ch3coona (sodium acetate) and nach3coo (sodium acetate trihydrate) are not the same thing. Sodium acetate is the anhydrous form, while sodium acetate trihydrate contains three molecules of water.


Is NaC2H3O2.3H2O sodium acetate trihydrate?

Yes, NaC2H3O2.3H2O is sodium acetate trihydrate. The "3H2O" indicates that there are three water molecules associated with each molecule of sodium acetate.


Sodium acetate from glacial acetic acid?

To prepare sodium acetate from glacial acetic acid, you can first neutralize the glacial acetic acid with sodium hydroxide. The reaction will yield sodium acetate and water. Afterward, you can evaporate the water to obtain solid sodium acetate crystals.


What is sodium acetate made?

Sodium acetate is typically produced by the reaction of acetic acid with sodium hydroxide or sodium carbonate. This reaction forms sodium acetate and water. The compound can also be obtained from the reaction of sodium hydroxide with acetic anhydride.


What do vinegar and baking soda create?

Carbon Dioxide, Water, and Sodium Acetate Sodium bicarbonate + acetic acid ---> sodium acetate + carbon dioxide + water (baking soda) (vinegar)


How is dry ice formed when sodium acetate is added to water?

Dry ice is not formed in this instance.Dry ice is solid carbon dioxide. The phenomenon involving sodium acetate is colloquially called hot ice. Simply adding sodium acetate to water will not produce this. You need to create a supersaturated solution. You add sodium acetate to water untill it cannot dissolve any more, and then cool the solution. Now you have an unstable solution that has more dissolved sodium acetate than it could normally hold. If it is disturbed, the sodium acetate will sponaneously crystallize.


Sodium acetate and water chemical equation?

the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).