0
Add your answer:
Earn +20 pts
Is sodium acetate soluble in water?
yes
Zinc acetate react with sodium phosphate?
sodium acetate and zinc phosphate
Is the reaction between Sodium acetate and water a chemical reaction?
No, it is simply the water dissolving the sodium acetate, which is a physical change. There is a physical change when you introduce a seed crystal to the sodium acetate as the bonds in the chemical become different to form a solid. By adding water, you are just dissolving it and then allowing it to become supersaturated through heating.
What is the name for the chemical formula NaOCOCH3?
Sodium acetate or Sodium ethanoate
How many formula units of sodium acetate are in 0.87 moles of sodium acetate?
How many formula units of sodium acetate are in 0.87 moles of sodium acetat
Is sodium acetate soluble or insoluble in water?
Sodium acetate is soluble in water.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
Spells to freeze water with your hand?
No, there are no spells to do such a thing. However, it is possible to create the illusion of instantly freezing water at a touch using a supersaturated solution of sodium acetate.
Is sodium acetate soluble in water?
yes
What do vinegar and baking soda create?
Carbon Dioxide, Water, and Sodium Acetate Sodium bicarbonate + acetic acid ---> sodium acetate + carbon dioxide + water (baking soda) (vinegar)
Is sodium acetate solution a metal?
No. Sodium acetate solution is a homogeneous mixture, which is a solution. Sodium acetate is an ionic compound formed from sodium ions and acetate ions. Sodium in sodium acetate no longer has the properties of sodium metal.
What causes water to freeze instantly?
You freeze water simply by cooling it to below 0 degrees Celsius. No special substance is required. If you are referring to the so-called "hot ice" the substance you use is sodium acetate. What you see happening in this case is not the water freezing, but rather the sodium acetate crystallizing from a supersaturated solution.
How is dry ice formed when sodium acetate is added to water?
Dry ice is not formed in this instance.Dry ice is solid carbon dioxide. The phenomenon involving sodium acetate is colloquially called hot ice. Simply adding sodium acetate to water will not produce this. You need to create a supersaturated solution. You add sodium acetate to water untill it cannot dissolve any more, and then cool the solution. Now you have an unstable solution that has more dissolved sodium acetate than it could normally hold. If it is disturbed, the sodium acetate will sponaneously crystallize.
Is CuCO3 soluble in water?
Yes, NaCH3COO (sodium acetate) is soluble in water as are all sodium compounds.
What is the trihydrate in sodium acetate as trihydrate crystals?
The term trihydrate refers to the fact that three molecules of water are associated with each formula unit of sodium acetate. The formula unit for sodium acetate trihydrate is NaC2H3O2‧3H2O.
What happens when sodium hydroxide is added to acetic acid?
sodium acetate and water are formed.
Why does soduim ascetate turn into ice?
Firstly, when sodium acetate (CH3COONa) solidifies, it does not form "ice". It just becomes solid. This happens when the sodium acetate is heated to about 100oC, then cooled below its freezing point. When a foreign substance with the same crystal structure as sodium acetate is introduced, or a nucleation centre is provided, the sodium acetate will warm up to its freezing point and freeze at its (supposed to be) freezing point.
