0
Pentene is an unstaturdated hydrocarbon (One that does not have many possible side branches)
It reacts readily with halogens to form new substances.
In this case, bromine reacts with pentene in an addition reaction, this changes pentene into 1,1-dibromopentane.
Thus, removing bromine from the solution, hence the distinct orange color is removed.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
Will saturated oils decolourise bromine?
No, unsaturated oils and fats (sunflower oil, olive oil) decolourise when reacted with bromine
Chemical reaction between phenol and bromine water?
it cant decolourise
What is the equation for addition of bromine to pentene?
Br2 + 2C5H10 = 2C5H8Br + 2H2
What is bromine and carbon tetrachloride?
Bromine in carbon tetrachloride is a brown-colored solution and used as a chemical test. When drops of bromine/carbon tetrachloride are added to a solution containing an unknown compound and the brown-colored bromine solution disappears, that means that the unknown compound contains carbon-carbon double bonds (since it absorbed the bromine solution). On the other hand, if the brown-colored bromine solution doesn't disappear then it means that no carbon double bonds are present. This is called a "Bromine Test."
The equation for the reaction between 2-pentene and bromine?
CH3-CH=CH-CH2-CH3 + Br2 = CH3-CH(Br)-CH(Br)-CH2-CH3
Why does alkyne decolourise bromine water?
The alkyne reacts with bromine removing it from the aqueous solution.
Will saturated oils decolourise bromine?
No, unsaturated oils and fats (sunflower oil, olive oil) decolourise when reacted with bromine
Chemical reaction between phenol and bromine water?
it cant decolourise
What is the major product formed on reaction of 1-pentene with bromine Br2?
1-bromo 1 pentene
What changes in color occur when bromine or KMnO4 reacts with an alkene?
The purple KMnO4 is decolourise
What is the equation for addition of bromine to pentene?
Br2 + 2C5H10 = 2C5H8Br + 2H2
Write an equation to illustrate how pentene reacts with bromine assume the pentene is ch3ch2ch equals chch3 and use structural formulas?
do you go to mvcc
When benzene reacts with bromine water will it decolourise bromine water or not?
No!! Benzene wont de colourise bromine water although it is an unsaturated compound ,as it is an aromatic compound and it does not undergo addition reaction.
What is the observation between bromine and propene?
Bromine water is a dilute solution of bromine that is normally orange-brown in colour, but becomes colourless when shaken with an alkene. Alkenes can decolourise bromine water, while alkanes cannot.
What is the different between saturated and unsaturated?
Saturated hydrocarbon does not decolourise bromine water while unsaturated hydrocarbon decolourize it.
Is bromine a solution?
NO!!! Bromine is an element, which exists in the liquid state at STP.
What happens if ethene is shaken with bromine water?
The solution will turn the orange bromine water into a colourless solution
