0
Br2 + 2C5H10 = 2C5H8Br + 2H2
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
Does pentene decolourise bromine solution?
Pentene is an unstaturdated hydrocarbon (One that does not have many possible side branches) It reacts readily with halogens to form new substances. In this case, bromine reacts with pentene in an addition reaction, this changes pentene into 1,1-dibromopentane. Thus, removing bromine from the solution, hence the distinct orange color is removed.
The equation for the reaction between 2-pentene and bromine?
CH3-CH=CH-CH2-CH3 + Br2 = CH3-CH(Br)-CH(Br)-CH2-CH3
What is the equation for the addition of bromine to 4-methylcyclohexene?
C6H9.CH3 + Br2 ---------------> C6H7(Br)2CH3.
What is the equation for bromine trifluoride?
Formula: BrF3
What is the symbol equation for sodium and bromine?
Sodium + Bromine ----> Sodium bromide2 Na + Br2 ----> 2 NaBr
Write an equation to illustrate how pentene reacts with bromine assume the pentene is ch3ch2ch equals chch3 and use structural formulas?
do you go to mvcc
Does pentene decolourise bromine solution?
Pentene is an unstaturdated hydrocarbon (One that does not have many possible side branches) It reacts readily with halogens to form new substances. In this case, bromine reacts with pentene in an addition reaction, this changes pentene into 1,1-dibromopentane. Thus, removing bromine from the solution, hence the distinct orange color is removed.
What is the major product formed on reaction of 1-pentene with bromine Br2?
1-bromo 1 pentene
The equation for the reaction between 2-pentene and bromine?
CH3-CH=CH-CH2-CH3 + Br2 = CH3-CH(Br)-CH(Br)-CH2-CH3
What is the equation for the addition of bromine to 4-methylcyclohexene?
C6H9.CH3 + Br2 ---------------> C6H7(Br)2CH3.
What is the balanced equation for the hydrogenation of 1 pentene?
I cannot answer this question.
What is the balanced equation for the combustion of bromine?
Bromine is not combustible
Why does bromine go clear after the addition of ethene?
Bromine is an electrophile (electron deficient species) it attacks the Carbon doubble bond and accepts a pair of electrons. this is known as electrophillic addition. the equation is: C2H4 + Br2 - C2H4Br2 the product is 1,2 dibromoethane. this product is colourless.
What is the equation for bromine trifluoride?
Formula: BrF3
Which equation has water as a product in the chemical reaction-?
bromine water? The reaction between hexene, bromine, and water is an addition reaction.
What is aluminum metal and diatomic bromine chemical equation?
The equation is, 2Al + 3Br2 = 2AlBr3
What is the symbol equation for sodium and bromine?
Sodium + Bromine ----> Sodium bromide2 Na + Br2 ----> 2 NaBr
