0
What else can I help you with?
How many moles of phosphorus atoms are in a 100 g sample of phosphorus?
The gram atomic mass of phosphorus is 30.9738, and by definition, a mole of such atoms contains Avogadro's Number of atoms. Therefore, 100 g of phosphorus contains 100/30.9738 or 3.23 moles, to the justified number of significant digits.
How many moles are in 2.3 grams of phosphorus using avogadro's number?
2.3 grams P (1mole P/30.97 grams) = 0.07427 moles Phosphorous 0.07427 moles P * 6.022 X 10^23 = 4.5 X 10^22 atoms of P in 2.3 grams P 4.5 X 10^22/6.022 X10^23 = 0.07427 moles of atoms in 2.3 grams of phosphorous
What isotope has 16 protons and 15 neutrons?
The isotope with 16 protons and 15 neutrons is oxygen-31.
How many protons and neutrons are there in the sulfur 36 isotope?
The sulfur atom has 16 protons and 16 electrons.The three stable isotopes of sulfur differ in their neutron number:Isotopes with mass number -32, -33 or -34 have 16, 17 or 18 neutrons respectively. The isotope with mass number 32 is the most abundant natural isotope.
What element has atomic number 16 and has 18 electrons?
SULFUR has 16 protons.But no neutral atom of an element can have MORE Electrons than Protons. This means that NO element can have 16 Protons and 18 Electrons.
How many atoms of hydrogen 31 grams in CH2O?
To find the number of moles in 31 grams of CH2O, we divide the mass by the molar mass of CH2O (30.03 g/mol). This gives us approximately 1.03 moles of CH2O. Since there are two hydrogen atoms in each molecule of CH2O, we multiply the number of moles by Avogadro's number (6.02 x 10^23) and by 2 to find about 1.24 x 10^24 hydrogen atoms.
How many different atoms in penicillin?
There are 31 atoms total in penicillin.
How many grams of naturally occurring phophorus must one have in order to have one mole of phosphorus?
One mole of phosphorus, which has a molar mass of about 31 grams per mole, contains 31 grams of naturally occurring phosphorus.
What is the mass of 7.21 x 1024 atoms P?
To find the mass of 7.21 x 10^24 atoms of phosphorus (P), you need to know the atomic mass of phosphorus. The atomic mass of phosphorus is approximately 31 grams per mole. By calculating the molar mass and dividing it by Avogadro's number, you can determine the mass of 7.21 x 10^24 atoms of phosphorus.
What is the gram molecular mass of phosphorous?
The atomic mass of phosphurus is 31. The atomic mass of chlorine is 35.5. Therefore, the gram molecular mass of PCl3 is 31+3x35.5=137.5 grams per mole.
How many moles of phosphorus atoms are in a 100 g sample of phosphorus?
The gram atomic mass of phosphorus is 30.9738, and by definition, a mole of such atoms contains Avogadro's Number of atoms. Therefore, 100 g of phosphorus contains 100/30.9738 or 3.23 moles, to the justified number of significant digits.
When was The True Confessions of Adrian Albert Mole created?
The True Confessions of Adrian Albert Mole was created on 1989-08-31.
How many atoms are present in 31 grams of magnesium fluoride?
MgF2 has a molecular weight of 24+19*2 = 62g. Thus, 31 grams of MgF2 represent .5mol. There are 6.022*10^23 particles per mole. Since MgF2 has three atoms in it, we can find the number of atoms by the following: (.5 mol)(6.022*10^23 particles/mol)(3 atoms in MgF2) = ... Enjoy your free high school chemistry answer!
How many moles are in 2.3 grams of phosphorus using avogadro's number?
2.3 grams P (1mole P/30.97 grams) = 0.07427 moles Phosphorous 0.07427 moles P * 6.022 X 10^23 = 4.5 X 10^22 atoms of P in 2.3 grams P 4.5 X 10^22/6.022 X10^23 = 0.07427 moles of atoms in 2.3 grams of phosphorous
What is the mass number for a sulfur atom that contains 31 neutrons?
The mass number is calculated by adding together the number of protons and neutrons in an atom. A sulfur atom typically has 16 protons, so if it contains 31 neutrons, the mass number would be 16 (protons) + 31 (neutrons) = 47.
How many hydrogen atoms are present in 3-methyl-4-propyl-3-octene?
CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3 24 hydrogen
What isotope has 16 protons and 15 neutrons?
The isotope with 16 protons and 15 neutrons is oxygen-31.
