0
What else can I help you with?
What happen when Calcium acetate react with ammonium carbonate?
When calcium acetate reacts with ammonium carbonate, calcium carbonate and ammonium acetate are formed. The balanced chemical equation for this reaction is: Ca(C2H3O2)2 + (NH4)2CO3 -> CaCO3 + 2CH3COOH + 2NH4HCO3
Net ionic equation for a solution of sodium acetate and a solution of ammonium sulfate?
The net ionic equation for mixing sodium acetate and ammonium sulfate solutions would be: 2CH3COO- (aq) + (NH4)2SO4 (aq) -> 2CH3COOH (aq) + (NH4)2SO4 (aq) Overall, the reaction results in the formation of acetic acid and ammonium sulfate.
What are the reactants of ammonium acetate and calcium sulfate?
This is a double replacement reaction which would look like this: 2NH4C2H3O2 + CaSO4 yields (NH4)2SO4 + Ca(C2H3O2)2 so the products are (NH4)2SO4, which is ammonium sulfate, and Ca(C2H3O2)2, which is calcium acetate. These are both soluble in water, so the reaction will reverse itself until it reaches equilibrium, usually indicated by an arrow pointed in either direction in the equation (if you have to balance the equation too).
Balanced reaction of ethyl acetate and NaoH?
NaOH+H3COOC2H5 --> CH3COONA+C2H5OHTo make the components more clear.(Na-OH)+(H3COO-C2H5) --> (CH3COO-NA)+(C2H5-OH)
What is the equation for dry distillation of calcium acetate?
The dry distillation of calcium acetate produces calcium acetone and calcium carbonate. The balanced equation for the reaction is: 2Ca(CH3COO)2(s) -> 2CaCO3(s) + (CH3)2CO(l).
Write a balanced equation to show the reaction of aqueous aluminum acetate with aqueous ammonium phosphate to form solid aluminum phosphate and aqueous ammonium acetate.?
The balanced equation is: 2Al(C2H3O2)3(aq) + 3(NH4)3PO4(aq) → AlPO4(s) + 6NH4C2H3O2(aq)
What is the reaction between Ethanoic acid and Ammonium Hydroxide?
The reaction between ethanoic acid and ammonium hydroxide forms ammonium acetate, water, and ammonia gas. The balanced chemical equation for this reaction is: CH3COOH + NH4OH -> NH4CH3COO + H2O + NH3.
What happen when Calcium acetate react with ammonium carbonate?
When calcium acetate reacts with ammonium carbonate, calcium carbonate and ammonium acetate are formed. The balanced chemical equation for this reaction is: Ca(C2H3O2)2 + (NH4)2CO3 -> CaCO3 + 2CH3COOH + 2NH4HCO3
Balanced equation for the reaction of acetic acid and ammonium hydroxide?
CH3COOH+NH4OH turns into H2O+CH3COONH4 have fun with chem
What is the balanced equation of barium acetate and potassium iodide?
The balanced chemical equation for the reaction between barium acetate and potassium iodide is: Ba(CH3COO)2 + 2KI -> BaI2 + 2KCH3COO
What is the balanced molecular equation for sodium acetate and silver nitrate?
The balanced molecular equation for the reaction between sodium acetate (NaC2H3O2) and silver nitrate (AgNO3) is: 2NaC2H3O2 + AgNO3 -> 2AgC2H3O2 + NaNO3
What two products are formed from a reaction of ammonia and vinegar?
The reaction of ammonia and vinegar forms ammonium acetate and water. Ammonium acetate is a salt commonly used in chemical reactions and laboratory experiments.
What is the reaction of sulphite plus lead acetate?
When sulphite reacts with lead acetate, it forms lead sulphite and lead acetate. The balanced chemical equation for this reaction is: Pb(CH3COO)2 + SO3^2- -> PbSO3 + 2CH3COO-
Net ionic equation for a solution of sodium acetate and a solution of ammonium sulfate?
The net ionic equation for mixing sodium acetate and ammonium sulfate solutions would be: 2CH3COO- (aq) + (NH4)2SO4 (aq) -> 2CH3COOH (aq) + (NH4)2SO4 (aq) Overall, the reaction results in the formation of acetic acid and ammonium sulfate.
What is the balanced equation for the reaction between acetic acid and sodium acetate?
There is no reaction between these two substances because an exchange of positive ions wouldn't result in higher product stability. Make sure your not confusing acetic with ascetic.
What are the reactants of ammonium acetate and calcium sulfate?
This is a double replacement reaction which would look like this: 2NH4C2H3O2 + CaSO4 yields (NH4)2SO4 + Ca(C2H3O2)2 so the products are (NH4)2SO4, which is ammonium sulfate, and Ca(C2H3O2)2, which is calcium acetate. These are both soluble in water, so the reaction will reverse itself until it reaches equilibrium, usually indicated by an arrow pointed in either direction in the equation (if you have to balance the equation too).
Balanced reaction of ethyl acetate and NaoH?
NaOH+H3COOC2H5 --> CH3COONA+C2H5OHTo make the components more clear.(Na-OH)+(H3COO-C2H5) --> (CH3COO-NA)+(C2H5-OH)
