0
What else can I help you with?
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What compound is h3c o ch3?
The compound with the formula H3C-O-CH3 is dimethyl ether, which is an ether consisting of two methyl groups (CH3) connected by an oxygen atom. It can be represented as CH3OCH3. Dimethyl ether is a colorless gas at room temperature and is used as a solvent, a fuel, and in the production of various chemicals.
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What do you mean by C2H6?
It is the chemical formula for the gas, Ethane. You may be able to visualize it better if we write the formula as: CH3 - CH2 - CH3
What is CH3-CH2-CH2-F CH3?
The compound CH3-CH2-CH2-F is 1-fluoropropane, a halogenated derivative of propane. It is a colorless gas commonly used as a refrigerant. The CH3 after F represents another methyl group attached to the carbon chain.
What is 2-2-4-4-tetramethylpentane?
2,2,4,4-tetramethylpentane is a branched-chain hydrocarbon with the chemical formula C9H22. It is commonly used as a reference compound in gas chromatography because of its unique structure and boiling point.
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What substance does C3 H8 represent?
C3H8 is PROPANE. Structurally it is CH3-CH2-CH3
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the extended structural formula of 2-methyl propane?
Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
what is the formula for "2-bromo-2-methylpropane + H2O →2-methylpropan-2-ol + HBr"?
CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr
