it is methyl gas
CH3-CH2-CH3 is a gas Propane.
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
The compound with the formula H3C-O-CH3 is dimethyl ether, which is an ether consisting of two methyl groups (CH3) connected by an oxygen atom. It can be represented as CH3OCH3. Dimethyl ether is a colorless gas at room temperature and is used as a solvent, a fuel, and in the production of various chemicals.
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
CH3-CH2-CH3 is a gas Propane.
It is the chemical formula for the gas, Ethane. You may be able to visualize it better if we write the formula as: CH3 - CH2 - CH3
The compound CH3-CH2-CH2-F is 1-fluoropropane, a halogenated derivative of propane. It is a colorless gas commonly used as a refrigerant. The CH3 after F represents another methyl group attached to the carbon chain.
2,2,4,4-tetramethylpentane is a branched-chain hydrocarbon with the chemical formula C9H22. It is commonly used as a reference compound in gas chromatography because of its unique structure and boiling point.
C3H8 is PROPANE. Structurally it is CH3-CH2-CH3
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3
CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3