It is a molecular solid.
Ch3coo(-) + h2o ---> ch3cooh + oh(-)
What is the balanced equation for Ch3COOH alone
an amorphous solid
There are three types of atoms in acetic acid (or vinegar). They are carbon (C), hydrogen (H) and oxygen (O).
network solid-APEX
In vinegar? CH3COOH That is acetic acid.
NaHCO3 + CH3COOH-------------CH3COONa + CO2 + H2O
The conjugate base of CH3COOH is CH3COO-. This forms when CH3COOH loses a proton (H+).
Same as in natural one, acetic acid with a chemical formula CH3COOH. :).
it is sometimes known as ethanoic acid.... it is CH3COOH... it is around 3 on the pH scale..
carbon oxygen hydrogen = CH3COOH is the thingy for vinegar
Acetic Acid, CH3COOH, has a molecular weight of 60.05
It is CH3COOH
Ch3coo(-) + h2o ---> ch3cooh + oh(-)
Network solid
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the balanced equation for Ch3COOH alone