0
What else can I help you with?
What is the product of CH3COOH plus (C2H5)2O?
Ch3coo(-) + h2o ---> ch3cooh + oh(-)
Balanced equation CH3COOH?
What is the balanced equation for Ch3COOH alone
What kind of solid breaks with no pattern?
an amorphous solid
How many different kind of atoms does CH3COOH have?
There are three types of atoms in acetic acid (or vinegar). They are carbon (C), hydrogen (H) and oxygen (O).
What kind of solid is crystalline boron ( B )?
network solid-APEX
What kind of acid is in viniga?
In vinegar? CH3COOH That is acetic acid.
Balanced net ionic equation for solid baking soda and aqueous vinegar?
NaHCO3 + CH3COOH-------------CH3COONa + CO2 + H2O
What is the conjugate base of CH3COOH?
The conjugate base of CH3COOH is CH3COO-. This forms when CH3COOH loses a proton (H+).
What kind of acid is acetic acid?
it is sometimes known as ethanoic acid.... it is CH3COOH... it is around 3 on the pH scale..
What kind of acid contained in synthetic vineger?
Same as in natural one, acetic acid with a chemical formula CH3COOH. :).
What is the chemical symbol for vinegar?
carbon oxygen hydrogen = CH3COOH is the thingy for vinegar
What is the mole in CH3COOH?
Acetic Acid, CH3COOH, has a molecular weight of 60.05
What is the acitic acid formula?
It is CH3COOH
What is the product of CH3COOH plus (C2H5)2O?
Ch3coo(-) + h2o ---> ch3cooh + oh(-)
What kind of solid is crystalline B?
Network solid
Balanced equation CH3COOH?
What is the balanced equation for Ch3COOH alone
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
