0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
How many grams of sodium oxide will be formed if 46 grams of sodium are use?
46 grams of sodium is 2 moles. 2 mol of sodium forms 1 mol of sodium oxide. So it makes 62 g of sodium oxide.
What is decomposition of AgCl?
Decomposition of sodium chloride by electrolysis:- in water solution: 2 NaCl + 2 H2O = 2 NaOH + H2 + Cl2- molten sodium chloride: 2 NaCl----------->2 Na + Cl2
What is the difference between sodium sulphate and sodium thiosulphate?
The polyatomic anions in sodium sulphate have the formula SO4-2, while the polyatomic anions in sodium thiosulphate have the formula S2O3-2.
Why does 1-chlorohexane have a higher boiling point than 1-iodohexane?
1-Chlorohexane has a higher boiling point than 1-iodohexane due to differences in intermolecular forces. Chlorine is more electronegative than iodine, resulting in stronger dipole-dipole interactions in 1-chlorohexane. These stronger intermolecular forces require more energy to overcome, leading to a higher boiling point.
What is a balanced chemical equation for sodium water gives sodium hydroxide plus hydrogen?
Yes, the water and sodium produce sodium hydroxide and hydrogen!
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the equation of 2 iodohexane with sodium methoxide?
CH-ch-ch-ch-ch-ch-naoh--------------->ch3-oh
Predict the two most likely mechanisms which occur when 2-iodohexane is heated in ethanol?
SN2 and SN1
What is sodium trideceth sulfate?
Sodium trideceth sulfate is sodium 2-[2-[2-(tridecyloxy)ethoxy]ethoxy]ethyl sulphate.
How does water dissolve sodium?
Water doesn't dissolve sodium, water react violently with sodium:2 Na + 2 H2O = 2 NaOH + H2
What is the daily sodium intake for an average teenager?
From 2 g to 5 g sodium chloride (approx. 1-2 g sodium).
How many grams of sodium oxide will be formed if 46 grams of sodium are use?
46 grams of sodium is 2 moles. 2 mol of sodium forms 1 mol of sodium oxide. So it makes 62 g of sodium oxide.
What is decomposition of AgCl?
Decomposition of sodium chloride by electrolysis:- in water solution: 2 NaCl + 2 H2O = 2 NaOH + H2 + Cl2- molten sodium chloride: 2 NaCl----------->2 Na + Cl2
What is the difference between sodium sulphate and sodium thiosulphate?
The polyatomic anions in sodium sulphate have the formula SO4-2, while the polyatomic anions in sodium thiosulphate have the formula S2O3-2.
What is the ratio pf sodium from sodium carbonate?
Sodium Carbonate (Na2CO3) has a ratio of 2 Sodium atoms to 1 Carbon atom, to 3 Oxygen atoms; Na:C:O 2 : 1 : 3
Why does 1-chlorohexane have a higher boiling point than 1-iodohexane?
1-Chlorohexane has a higher boiling point than 1-iodohexane due to differences in intermolecular forces. Chlorine is more electronegative than iodine, resulting in stronger dipole-dipole interactions in 1-chlorohexane. These stronger intermolecular forces require more energy to overcome, leading to a higher boiling point.
What is the symbol equation for sodium and bromine?
Sodium + Bromine ----> Sodium bromide2 Na + Br2 ----> 2 NaBr
