answersLogoWhite

0

esters

User Avatar

Wiki User

14y ago

What else can I help you with?

Related Questions

What class of oxygen-containing molecules does this molecule belong to h o ch3?

CH3OH is methyl alcohol or methanol, an alcohol


What organic compounds class does octanal belong to?

Octanal is an aldehyde with the chemical formula CH3(CH2)6CHO.


What is CH3 gas?

CH3 gas does not exist as a standalone molecule. It likely refers to the methyl group, which is a common component of organic molecules and appears as CH3 when attached to other atoms.


Composition of rubbing Alcohol?

Isopropanol (isopropyl alcohol) usually diluted to 75% strength. And this question really doesn't belong in the Mental Health category.


Is CH3 CH216 CO2H polar or nonpolar?

The compound known as CH3(CH2)16CO2H is typically considered polar. Its molecules are able to have dipole moments, and it is soluble in water.


Is ch3 a organic molecule?

yes because it contains carbon so it is organic


What is cracking and reforming?

Craking is the process whereby complex molecules are broken down into simpler molecules : Example : C36H74 + H2 >> C2H6 + C34H70 Reforming is a process used to convert molecules having low octane ratings into hight- octane liquid products Example CH3(CH2)6CH3 >> CH3C(CH3)2CH2CH(CH3)CH3


What is CH3 used in?

CH3 is a chemical formula representing a methyl group, which is a common functional group found in organic compounds. It can be found in various molecules such as methane (CH4) and methyl alcohol (CH3OH).


Is CH3 hydrophobic?

methyl is hydrophobic because it is non polar. the c-h bonds have little electronegativity difference I believe. water is polar, and nonpolar things don't tend to react or dissolve in polar substances.


What does CH3 mean in science?

CH3 in science represents a methyl group, which is a hydrocarbon unit composed of one carbon atom bonded to three hydrogen atoms. It is often found in organic chemistry as a building block for larger molecules.


What 2 4?

CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane


Is the most complex organic molecules are hydrocarbon chains with nothing else attached?

No, the most complex organic molecules can have a variety of functional groups attached to hydrocarbon chains, such as alcohols, carboxylic acids, amines, and more. These functional groups can significantly alter the properties and reactivity of the molecules.