answersLogoWhite

0

yes because it contains carbon so it is organic

User Avatar

Wiki User

∙ 16y ago

What else can I help you with?

Related Questions

What is the name for the molecule ch3?

CH3 is not the formula for any stable molecule; it is the formula of a "methyl radical".


What is CH3 gas?

CH3 gas does not exist as a standalone molecule. It likely refers to the methyl group, which is a common component of organic molecules and appears as CH3 when attached to other atoms.


How do you name this molecule ch3 ch2 ch3?

CH3-CH2-CH3 is a gas Propane.


What does CH3 mean in science?

CH3 in science represents a methyl group, which is a hydrocarbon unit composed of one carbon atom bonded to three hydrogen atoms. It is often found in organic chemistry as a building block for larger molecules.


What is the molecule ch3 ch2 ch2 o ch2 ch3?

The molecule is called ethyl ether, which has the chemical formula CH3CH2OCH2CH3. It is commonly used as a solvent and as a starting material in organic synthesis reactions. Ethyl ether is a volatile liquid with a sweet odor and is highly flammable.


What is the name for this molecule ch3 ch2 ch3?

The molecule is called propane. It is a three-carbon alkane with the chemical formula C3H8.


What is the atomicity of CH3?

4 atoms are present in one molecule of CH3 So it is Polyatomic


What is the chemical formula for 2-methyl-2hexene?

A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.


What is the name of the molecule ch3?

2-butyne


Is -CH3 in a functional group?

No, -CH3 is not a functional group. It is a methyl group, which is a common substituent in organic chemistry but not a functional group by itself.


WHAT IS THE IUPAC name of the organic compound ch3 cch-co-ch3?

PENTAN-3-EN-2-ONE


Are there unshared pairs in CH3?

No, there are no lone pairs in a molecule of CH3. All atoms in CH3 are involved in bonding, so there are no unshared pairs of electrons on the carbon or hydrogen atoms.