yes because it contains carbon so it is organic
CH3-CH2-CH3 is a gas Propane.
CH3 gas does not exist as a standalone molecule. It likely refers to the methyl group, which is a common component of organic molecules and appears as CH3 when attached to other atoms.
The molecule is called ethyl ether, which has the chemical formula CH3CH2OCH2CH3. It is commonly used as a solvent and as a starting material in organic synthesis reactions. Ethyl ether is a volatile liquid with a sweet odor and is highly flammable.
4 atoms are present in one molecule of CH3 So it is Polyatomic
No, -CH3 is not a functional group. It is a methyl group, which is a common substituent in organic chemistry but not a functional group by itself.
CH3 is not the formula for any stable molecule; it is the formula of a "methyl radical".
CH3-CH2-CH3 is a gas Propane.
CH3 gas does not exist as a standalone molecule. It likely refers to the methyl group, which is a common component of organic molecules and appears as CH3 when attached to other atoms.
CH3 in science represents a methyl group, which is a hydrocarbon unit composed of one carbon atom bonded to three hydrogen atoms. It is often found in organic chemistry as a building block for larger molecules.
The molecule is called ethyl ether, which has the chemical formula CH3CH2OCH2CH3. It is commonly used as a solvent and as a starting material in organic synthesis reactions. Ethyl ether is a volatile liquid with a sweet odor and is highly flammable.
The molecule is called propane. It is a three-carbon alkane with the chemical formula C3H8.
4 atoms are present in one molecule of CH3 So it is Polyatomic
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
No, -CH3 is not a functional group. It is a methyl group, which is a common substituent in organic chemistry but not a functional group by itself.
2-butyne
PENTAN-3-EN-2-ONE
No, there are no lone pairs in a molecule of CH3. All atoms in CH3 are involved in bonding, so there are no unshared pairs of electrons on the carbon or hydrogen atoms.