0
What else can I help you with?
What is the name for this molecule ch3 ch2 ch3?
The molecule is called propane. It is a three-carbon alkane with the chemical formula C3H8.
What is the name for compound CH2CH2CH3?
CH2CH2CH3 is NOT a compound name, but a 'Propyl' functional group , which would be attached to a larger molecule. Propane is CH3-CH2-CH3 Propene is CH2=CH-CH3 Propyne is HC=C-CH3 ( A triple bond). The CH2CH2CH2, is written as R-CH2CH2CH3 , the propyl functional group and 'R' the rest of the molecule.
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the name for ch3chch3chch3ch3?
The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.
Is the molecule CH C CH3 of 1-propane?
No, the molecule CH3CH2CH3 represents 1-propane. The molecule CH2CHCH3 does not exist.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name for this molecule ch3 ch2 ch3?
The molecule is called propane. It is a three-carbon alkane with the chemical formula C3H8.
What is the name of the molecule ch3?
2-butyne
What is the name for compound CH2CH2CH3?
CH2CH2CH3 is NOT a compound name, but a 'Propyl' functional group , which would be attached to a larger molecule. Propane is CH3-CH2-CH3 Propene is CH2=CH-CH3 Propyne is HC=C-CH3 ( A triple bond). The CH2CH2CH2, is written as R-CH2CH2CH3 , the propyl functional group and 'R' the rest of the molecule.
What is the atomicity of CH3?
4 atoms are present in one molecule of CH3 So it is Polyatomic
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
What is the name of ch3-ch2-ch2-ch3 with single bondof ch3?
The molecule is called butane. It consists of four carbon atoms in a chain with each carbon having hydrogen atoms attached, including the end carbons which each have 3 hydrogens.
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the name for ch3chch3chch3ch3?
The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.
Are there unshared pairs in CH3?
No, there are no lone pairs in a molecule of CH3. All atoms in CH3 are involved in bonding, so there are no unshared pairs of electrons on the carbon or hydrogen atoms.
Is the molecule CH C CH3 of 1-propane?
No, the molecule CH3CH2CH3 represents 1-propane. The molecule CH2CHCH3 does not exist.
What is the name for the ch3-ch-ch3?
1-pentanol
