answersLogoWhite

0

CH3 is not the formula for any stable molecule; it is the formula of a "methyl radical".

User Avatar

Wiki User

13y ago

What else can I help you with?

Related Questions

How do you name this molecule ch3 ch2 ch3?

CH3-CH2-CH3 is a gas Propane.


What is the name for this molecule ch3 ch2 ch3?

The molecule is called propane. It is a three-carbon alkane with the chemical formula C3H8.


What is the name of the molecule ch3?

2-butyne


What is the name for compound CH2CH2CH3?

CH2CH2CH3 is NOT a compound name, but a 'Propyl' functional group , which would be attached to a larger molecule. Propane is CH3-CH2-CH3 Propene is CH2=CH-CH3 Propyne is HC=C-CH3 ( A triple bond). The CH2CH2CH2, is written as R-CH2CH2CH3 , the propyl functional group and 'R' the rest of the molecule.


What is the atomicity of CH3?

4 atoms are present in one molecule of CH3 So it is Polyatomic


What is the chemical formula for 2-methyl-2hexene?

A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.


What is the name of ch3-ch2-ch2-ch3 with single bondof ch3?

The molecule is called butane. It consists of four carbon atoms in a chain with each carbon having hydrogen atoms attached, including the end carbons which each have 3 hydrogens.


What is the name for the CH3-Ch-CH3 alkyl group?

The name for the CH3-Ch-CH3 alkyl group is isopropyl.


What is the name for ch3chch3chch3ch3?

The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.


Are there unshared pairs in CH3?

No, there are no lone pairs in a molecule of CH3. All atoms in CH3 are involved in bonding, so there are no unshared pairs of electrons on the carbon or hydrogen atoms.


What is the name for the ch3-ch-ch3?

1-pentanol


Is the molecule CH C CH3 of 1-propane?

No, the molecule CH3CH2CH3 represents 1-propane. The molecule CH2CHCH3 does not exist.