CH3 is a chemical formula representing a methyl group, which is a common functional group found in organic compounds. It can be found in various molecules such as methane (CH4) and methyl alcohol (CH3OH).
CH3-CH2-CH3 is a gas Propane.
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
The process mentioned involves the breaking of a C-C bond in decane to form 1-butene and 2-methylpentane. The structural formula equation is: CH3-(CH2)8-CH3 → CH2=CH-CH2-CH3 + CH3-CH(CH3)-CH2-CH2-CH3.
For the anion in the covalent compound CH3, the Greek prefix used to represent it is "meth-." So, the anion in CH3 would be called "methide."
The Kb for (CH3)3N (trimethylamine) in water is a measure of the strength of the base (CH3)3NH in solution. It is used to calculate the equilibrium concentration of hydroxide ions (OH-) in solution when the base dissociates.
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
2,2,4,4-tetramethylpentane is a branched-chain hydrocarbon with the chemical formula C9H22. It is commonly used as a reference compound in gas chromatography because of its unique structure and boiling point.
The compound CH3-CH2-CH2-F is 1-fluoropropane, a halogenated derivative of propane. It is a colorless gas commonly used as a refrigerant. The CH3 after F represents another methyl group attached to the carbon chain.
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3
CH3-CH2-CH3 is a gas Propane.
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr