answersLogoWhite

0

CH3 is a chemical formula representing a methyl group, which is a common functional group found in organic compounds. It can be found in various molecules such as methane (CH4) and methyl alcohol (CH3OH).

User Avatar

AnswerBot

1y ago

What else can I help you with?

Related Questions

What In the Covalent compound CH3 the Greek Prefix used to represent the anion is?

For the anion in the covalent compound CH3, the Greek prefix used to represent it is "meth-." So, the anion in CH3 would be called "methide."


What is Kb for (CH3)3N(aq) H2O(l) (CH3)3NH (aq) OH-(aq)?

The Kb for (CH3)3N (trimethylamine) in water is a measure of the strength of the base (CH3)3NH in solution. It is used to calculate the equilibrium concentration of hydroxide ions (OH-) in solution when the base dissociates.


What 2 4?

CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane


What is 2-2-4-4-tetramethylpentane?

2,2,4,4-tetramethylpentane is a branched-chain hydrocarbon with the chemical formula C9H22. It is commonly used as a reference compound in gas chromatography because of its unique structure and boiling point.


What’s 2×4?

CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane


What is the correct structure of 3-ethyl-3-methylhexane?

The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3


What is CH3-CH2-CH2-F CH3?

The compound CH3-CH2-CH2-F is 1-fluoropropane, a halogenated derivative of propane. It is a colorless gas commonly used as a refrigerant. The CH3 after F represents another methyl group attached to the carbon chain.


What is the name for the CH3-Ch-CH3 alkyl group?

The name for the CH3-Ch-CH3 alkyl group is isopropyl.


What is the extended structural formula of 2-methyl propane?

Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3


How do you name this molecule ch3 ch2 ch3?

CH3-CH2-CH3 is a gas Propane.


Can you make two structural isomers from a saturated alkane C4H10?

n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3


what is the formula for "2-bromo-2-methylpropane + H2O →2-methylpropan-2-ol + HBr"?

CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr