0
Many compounds have this formula; for example tert-butylamine.
Bennett Bode
Add your answer:
Earn +20 pts
Is adenine polar or non polar?
Alanine is an amphoteric substance: both acidic and basic at the same time. However, it is neutral in a pH = 6.1 solution: CH3CH(NH3+)COO- It is positvely charged ( by excess of H+) at lower pH sol'n CH3CH(NH3+)COOH and negatively in pure water or more basic solution CH3CH(NH2)COO-.
What is condensed formula for 2 3 3 4 tetramethylnonane?
Ch3ch(ch3)c(ch3)2ch(ch3)(ch2)4ch3
How many isomers are there of c4h8?
There 4 isomers : 1) H2C=CHCH2CH3 => but-1-ene 2) CH3CH=CHCH3 => but-2-ene 3) (CH3)2C=CHCH3 => 2- methylpropene 4) CH2-CH2-CH2-CH2 => cyclobutane/cycloalkane. C4h8 has 3 isomers from the same homologous series and one that is not from the same homologous series.
2-pentanone to 2-pentanol distinguish?
2-pentanone is CH3(C=0)CH2CH2CH3 and is a ketone with a distinct smell. 2-pentanol is CH3CH(OH)CH2CH2CH3 and is an alcohol with completely different properties.
What is the proportion of aldehyde's and keaton's in islopropylalcohol?
iso-propyl alcohol = CH3CH(OH)CH3 so any possibility of aldehyde/ ketone formation is only one. i.e. acetone CH3(C=O)CH3
Is ch3ch equals chch2ch3 polar?
No, CH3CH=CHCH2CH3 (2-pentene) is a hydrocarbon. Hydrocarbons are nonpolar.
What is the drawing for Dichloroethane?
CH3CH-Cl2
What is the structure for 3-chlorobutanamide?
CH3CH(Cl)-CH2-CONH2
Is adenine polar or non polar?
Alanine is an amphoteric substance: both acidic and basic at the same time. However, it is neutral in a pH = 6.1 solution: CH3CH(NH3+)COO- It is positvely charged ( by excess of H+) at lower pH sol'n CH3CH(NH3+)COOH and negatively in pure water or more basic solution CH3CH(NH2)COO-.
What is the chemical name for isopropyl alcohol?
Ch3ch(oh)ch3
Which formula represents 2-butene?
Buthane is a saturated hydrocarbon. That means all the bonds found in this molecule are single covalent bond. Its formula is C4H10. It is the fourth member of the alkane siri.
How do you make lactic acid from Ethanal?
Firstly, ethanal is reacted with HCN to produce hydroxynitrile. CH3CHO +HCN -------> CH3CH(OH)CN Only then the hydroxynitrile is converted into carboxylic acid (lactic acid in this case) by heating under reflux with aqueous acids or alkalis (hydrolysis). CH3CH(OH)CN + 2H2O + H+ (proton) --------> CH3CH(OH)COOH +NH4+ (ammonium ion) Lactic acid basics can be found at bocsci(dot)com.
What is the reaction of lactic acid and water?
The overall reaction for lactic acid fermentation is an anaerobic reaction. This means that oxygen is not required for the reaction to take place.
What is the condensed structural formula for 3 ethyl 2 5 dimethyloctane?
Ch3ch(ch3)ch(ch2ch3)ch2ch(ch3)ch2ch2ch3
What is the formula for calcium lactate?
The formula of calcium lactate is [CH3CH(OH)COO]2Ca or C6H10CaO6.
What is the structural formula of propene?
The formula for propylene is CH3CH=CH2 and the Hill formula is C3H6. It has a boiling point of -53.68 degrees Fahrenheit.
What is condensed formula for 2 3 3 4 tetramethylnonane?
Ch3ch(ch3)c(ch3)2ch(ch3)(ch2)4ch3
