0
What else can I help you with?
Chemical equation of vinegar?
Vinegar is diluted acetic acid. The chemical formula for acetic acid is CH3COOH.
What is the chemical equation for white wine vinegar?
The chemical equation for white wine vinegar, which contains acetic acid, is CH3COOH. When acetic acid dissolves in water, it forms hydrogen and acetate ions, contributing to its acidic properties.
What is the Chemical equation for acetic acid and lithium hydroxide produce water and lithium acetate?
The chemical equation for acetic acid (CH3COOH) reacting with lithium hydroxide (LiOH) to produce water (H2O) and lithium acetate (LiCH3COO) can be represented as: CH3COOH + LiOH → H2O + LiCH3COO
Equation for combination of acetic acid-water-chloroform with sodium hydroxide?
The reaction of acetic acid and sodium hydroxide will form sodium acetate and water. The chloroform is not involved in the reaction and will remain unchanged. The balanced chemical equation for the reaction is: CH3COOH (acetic acid) + NaOH (sodium hydroxide) -> CH3COONa (sodium acetate) + H2O (water)
What is equation for sodium hydroxide and acetic acid?
The reaction between sodium hydroxide (NaOH) and acetic acid (CH3COOH) forms sodium acetate (CH3COONa) and water (H2O). The balanced chemical equation is: CH3COOH + NaOH -> CH3COONa + H2O.
Chemical equation for acetic acid?
Acetic acid and water doesn't react; they form a solution.
What is the chemical equation for sodium acetate with water amd acetic acid?
Any chemical reaction; a solution is obtained, containing ions as Na+ and the carboxy group -COOH.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the balanced chemical equation for the reaction acetic acid with aluminium hydroxide to form water and aluminium acetate?
The balanced chemical equation for the reaction between acetic acid (CH3COOH) and aluminum hydroxide (Al(OH)3) to form water and aluminum acetate (Al(CH3COO)3) is: 2CH3COOH + 3Al(OH)3 -> 3H2O + Al(CH3COO)3
What is the unbalanced chemical equation for the reaction of calcium metal with water?
The unbalanced chemical equation for the reaction of calcium metal with water is: Ca(s) + H2O(l) -> Ca(OH)2(aq) + H2(g).
What is the chemical equation for corrosion?
Metal+oxygen=metal oxide? im not sure but i think thats the right answer, or it could be metal+water=metal hydroxide+ hydrogen
What is the chemical equation of ethanoic acid reacting with sodium hydroxide?
The chemical equation for the reaction between ethanoic acid (acetic acid) and sodium hydroxide is: CH3COOH + NaOH → CH3COONa + H2O This reaction is a neutralization reaction that forms sodium acetate and water.
