The chemical formula of 2,4-dimethylphenol is C8H10O.
The formula is C5H9BrO.
the formula for the compound is C2H2 to express this in its simplest form devide each atom be a common number, here we can see that there is 2 of each atom so an emperical formula would be CH
C6H3Cl3 The benzene ring has 6 carbon atoms, each of which is given a number and this continues in a clockwise direction. Chlorine atoms are attached to carbons 1, 2 and 4.
The condensed structural formula for 3-ethyl-2,5-dimethyloctane is CH3CH(CH2CH3)CH(CH3)C(CH3)2CH2CH2CH3.
The condensed formula for 2,2,3-trimethylpentane is CH₃C(CH₃)₂CH(CH₃)₂CH₃.
The chemical formula of 2-hexenal is C6H10O.
This formula is C11H24.
C10H22 It is a chain of 7 carbons, with a branch on the 4th carbon, that branch is 3 carbons long.
Almost impossible to answer by this simple text editor of Answers.com, but let me try: (You can leave the '-'sign of the main string out) H3C-CH(CH3)-CH2-CH(C3H7)-CH2-CH(C2H5)-CH2-CH2-CH3
CH3C(CH3)2CH2CH(CH2CH3)CH2CH2CH2CH3 Remember, whatever is in brackets is connected to the carbon before it.
I'm guessing it would be something close to CH(CH2)5OH HEX...common... hex means 6 so there is 6 carbons in a row C-C-C-C-C-C Its ending is OL making it an alcohol which needs a OH on the end C-C-C-C-C-C-OH cyclo means its all connected. I cant do it on the computer but assume that the begining carbon and the ending carbon for a hexagon with a OH coming off the last Carbon. attach 2 hydrogens to the carbons except for the carbon with an OH. Just attach one on that one. Then your set!
What is the molecular formula of 2-Butyne