0
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa -------->
CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
What is the equation of 2 iodohexane with sodium methoxide?
CH-ch-ch-ch-ch-ch-naoh--------------->ch3-oh
What is the symbol equation for sodium and bromine?
Sodium + Bromine ----> Sodium bromide2 Na + Br2 ----> 2 NaBr
What is the word equation for sodium hydroxide?
Sodium Hydroxide + Hydrocloric acid --> Sodiumchloride + Water
Predict the two most likely mechanisms which occur when 2-iodohexane is heated in ethanol?
SN2 and SN1
Equation in the reactions of benzyl alcohol and sodium metal?
2 Benzyl alcohol + 2 Na ---> H2(g) + 2 sodium benzoate
What is the equation of 2 iodohexane with sodium methoxide?
CH-ch-ch-ch-ch-ch-naoh--------------->ch3-oh
What is the symbol equation for sodium and bromine?
Sodium + Bromine ----> Sodium bromide2 Na + Br2 ----> 2 NaBr
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the balanced equation for sodium bromide from sodiumand bromine?
This equation is 2 Na + Br2 -> 2 NaBr.
What is the equatuion of sodium oxide?
The formula [not equation!] of sodium oxide is Na2O. A possible equation for forming it is 4 Na + O2 -> 2 Na2O.
What is the word equation for sodium hydroxide?
Sodium Hydroxide + Hydrocloric acid --> Sodiumchloride + Water
What is the chemical equation for sodium oxide reacts with water to produce sodium hydroxide?
Na2O(s) + H2O(l) = 2NaOH(aq) Like sodium metal , sodium oxide reacts with water, however, it does NOT liberate hydrogen, so there is no 'popping' or flashing flame. Na2O is a BASE NaOH is an ALKALI (Soluble Base)
What is a balanced equation for decomposition of sodium hydrogen carbonate?
The chemical equation is:2 NaHCO3---------------------Na2O + 2 CO2 + H2O
Equation in the reactions of benzyl alcohol and sodium metal?
2 Benzyl alcohol + 2 Na ---> H2(g) + 2 sodium benzoate
What is the equation for sodium nitrate and copper III iodide?
the equation for sodium nitrate and copper III iodide can be given below.Cu I 2 +2 Na No3 ->I (NO3)2 + 2NaI. this is the balance reaction for the above.
Predict the two most likely mechanisms which occur when 2-iodohexane is heated in ethanol?
SN2 and SN1
What is the equation for the reaction of 2-propanol and sodium dichromate?
It will be a ketone attached to the second carbon of the propanol (in place of the OH) if treated with a mild oxidant.
