answersLogoWhite

0

The molecule you have described (C8H18) is Octane. The number of carbon atoms in the longest molecule chain give the first part of the IUPAC name.

C Atom Number - First Part

1 ---------------------Meth

2 ---------------------Eth

3 ---------------------Prop

4 ---------------------But

5 ---------------------Pent

6 ---------------------Hex

7 ---------------------Hept

8 ---------------------Oct

Type of Molecule - Suffix

Alkane ----------------ane

Alkene ----------------ene

Alcohol ----------------anol

Ketone ---------------one

Aldehyde -------------anal

Carboxylic Acid ------oic Acid

User Avatar

Pearline Blick

Lvl 13
4y ago

What else can I help you with?

Related Questions

What is the structure for octane?

Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3


What is condensed formula for 2 3 3 4 tetramethylnonane?

The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.


What is ch2 equals c-ch3-ch2-ch2-ch3?

The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br


What is the proper configuration of a straight chain isomer of hexane?

Ch3-ch2-ch2-ch2-ch2-ch3


What are the structural isomers for C6H10?

1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3


What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?

The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.


What is the IUPAC name for CH3-CH2-CH2-CH2-Br?

1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.


How do you name this molecule ch3 ch2 ch3?

CH3-CH2-CH3 is a gas Propane.


What is the reaction equation of 1-butene and water?

Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3


Decane can be broken during this process to form 1- butene and 2 - methylpentanewrite anequation using structural formulae to show this reaction?

The process mentioned involves the breaking of a C-C bond in decane to form 1-butene and 2-methylpentane. The structural formula equation is: CH3-(CH2)8-CH3 → CH2=CH-CH2-CH3 + CH3-CH(CH3)-CH2-CH2-CH3.


What is the of 4 4?

4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.


What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?

Cyclopentyl ethyl ester