0
2-bromo-3-iodobutane
3
3-
What else can I help you with?
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the name for ch3chch3chch3ch3?
The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the common name for (CH3)3CCl?
The common name for (CH3)3CCl is t-butyl chloride.
What is the name of the compound CH3CH(CH3)C(CH3)?
The compound is called 2,2,3-trimethylbutane.
How do you convert n-propylbromide to 2.3-dimethylbutane?
1-dehydrohalogenation of n-propylbromide which gives the propene. CH3-CH2-CH2-Br + KOH(Alcoholic) -----> CH3-CH=CH2 2-again hydrohalogenation with HBr gives mostly iso-propylbromide,(Markonikov's rule). CH3-CH=CH2 + HBr ------> CH3-CHBr-CH3 3-The reaction of iso-propylbromide with Sodium metal in presence of anhydrous ether (Wurtz reaction) gives the 2,3-dimethylbutane. 2(CH3-CHBr-CH3) + 2Na ---anhydrous ether--->CH3-CHCH3-CHCH3-CH3
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the name for ch3chch3chch3ch3?
The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name for the ch3-ch-ch3?
1-pentanol
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the common name of the compound CH3 CH3?
o-diethylbenzene
What is the complete structural formula for 1-2-Dibromoethane?
Br Br | |H - C - C - H| |H H
What is the common name for (CH3)3CCl?
The common name for (CH3)3CCl is t-butyl chloride.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
What is the name of compound CH3 3?
The compound CH3 is known as methyl group. It is a functional group consisting of a carbon atom bonded to three hydrogen atoms.
