0
What else can I help you with?
Is oleic acid soluble in sodium hydroxide?
Yes, oleic acid is soluble in sodium hydroxide due to the formation of soap through a saponification reaction. Oleic acid reacts with sodium hydroxide to form sodium oleate, which is a soluble soap compound.
What is the state of phosphorus trichloride at room temperature?
Phosphorus trichloride is a colorless liquid at room temperature. It has a strong and unpleasant odor resembling that of hydrochloric acid.
What state is bromine at room temperature?
The element bromine is in the state of a liquid at room temperature (room temperature is roughly 20 degrees Celsius). This is because it's boiling point is 59 degrees Celsius, which is 39 degrees more then room temperature.
What is the state of matter of C2H6N2?
This is hydrochloric acid and it is a liquid
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
Are liquids unsaturated at room temperature?
Fats that have a lot of oleic acid in them, such as unsaturated fats, are liquid at room temperature. They are known to us as oils.
What would the simulation have shown if oleic acid was added to water?
If oleic acid was added to water in a simulation, it would likely show the acid forming micelles or aggregates due to its amphiphilic properties. The hydrophobic tail of oleic acid would cluster together, while the hydrophilic head would interact with the water molecules, resulting in the formation of micelles to minimize exposure of the hydrophobic tails to water.
What is the formula of oleic acid?
The formula of olecic acid is C17H33COOH. It is an unsaturated fatty acid
Why is the melting point of Palmitoleic acid lower than that of oleic acid?
The presence of a cis-double bond at a higher position in oleic acid compared to palmitoleic acid increases the intermolecular forces between oleic acid molecules. These stronger intermolecular forces in oleic acid require more energy to overcome, resulting in a higher melting point compared to palmitoleic acid.
Is oleic acid a compound?
Oleic Acid is a Chemical Compound. It is an unsaturated fatty acid that is the most widely distributed and abundant fatty acid in nature.
What is the name of an oily liquid occurring in almost all natural fats - spelled o-e-c?
The oily liquid occurring in almost all natural fats is called "oleic acid." It is a monounsaturated omega-9 fatty acid commonly found in olive oil, nuts, and animal fats. Oleic acid has been linked to various health benefits, including reducing inflammation and improving heart health.
What is the reaction of iodine and oleic acid?
When iodine reacts with oleic acid, it forms iodine addition products. These products result from the addition of iodine across the C=C double bonds present in oleic acid. The reaction typically involves the formation of di-iodo derivatives of oleic acid.
Is oleic acid soluble dilute NaOH?
Yes, oleic acid is soluble in dilute NaOH due to the formation of soap through saponification reaction. Oleic acid reacts with NaOH to form the sodium salt of oleic acid, which is a soap that is water-soluble.
What typre of bond is oleic acid?
Oleic acid is a type of fatty acid that contains a C-C double bond, making it a monounsaturated fatty acid.
What acid is a body fat compound?
Oleic Acid
What happens when oleic acid is added to water?
Oleic acid is a fatty acid that is insoluble in water due to its long hydrocarbon chain. When added to water, oleic acid will form a separate layer on top of the water due to its hydrophobic nature. This separation is due to the difference in polarity between the water molecules and the nonpolar oleic acid molecules.
Is oleic acid soluble in chloroform?
Yes, oleic acid is soluble in chloroform due to its non-polar nature. Chloroform is a non-polar solvent, allowing for the dissolution of non-polar compounds like oleic acid.
