0
Oleic acid at (30°C) the visocity is 25.6
Wiki User
∙ 14y ago
Wiki User
∙ 15y agoyes
Add your answer:
Earn +20 pts
Is oleic acid soluble in sodium hydroxide?
Yes it is, oleic acid (18 carbon Chain carboxylic acid) will react with the Sodium Hydroxide (NaOH) and produce a new metal salt carboxylic acid.
What would happen if liquid hypochloric acid were poured on calcium hypochlorite?
Most likely nothing.
What state is bromine at room temperature?
The element bromine is in the state of a liquid at room temperature (room temperature is roughly 20 degrees Celsius). This is because it's boiling point is 59 degrees Celsius, which is 39 degrees more then room temperature.
What is the balanced equation for the reaction of oleic acid and sodium hydroxide?
First you need the formula for the two starting ingredients. Sodium hydroxide is NaOH and Tartaric acid is HOOC--CH(OH)--CH(OH)--COOH. This can be found by looking at for example, the related link. Other searches will show that NaOH reacts with a carboxylic acid thus: -----COOH + NaOH -----> COONa +H2O in general terms. So putting all this information together we know that 2 molecules of NaOH will be needed per molecule of tartaric acid. So the final reaction equation is HOOC-CH(OH)-CH(OH)-COOH +2NaOH ----> NaOOC-CH(OH)-CH(OH)-COONa + 2H20
What is the isomer of acetic acid?
Some isomers are, after NIST:- methyl formate- hydroxy acetaldehyde- 1,2-dioxietane- ethene-1,2-diol- (Z)ethene -1,2-diol- formaldehyde dimer
Are liquids unsaturated at room temperature?
Fats that have a lot of oleic acid in them, such as unsaturated fats, are liquid at room temperature. They are known to us as oils.
What would the simulation have shown if oleic acid was added to water?
Oleic acid is not miscible with water.
What is an example of a fatty acid?
CH3CH3 ethane is saturated. CH2=CH2 ethene (ethylene) is unstaurated. C17H35COOH stearic acid is saturated. C17H33COOH oleic acid is unsaturated. C17H29COOH Linolenic acid is polyunstaurated.
Is oleic acid a compound?
Oleic Acid is a Chemical Compound. It is an unsaturated fatty acid that is the most widely distributed and abundant fatty acid in nature.
Why is the melting point of Palmitoleic acid lower than that of oleic acid?
because palmitoleic acid has less number of carbons than oleic acid
Why is a dilute solution of oleic acid used instead of pure oleic acid?
The text is asking why a solution of oleic acid that has been weakened with water is used instead of pure oleic acid. Oleic acid is a type of fatty acid commonly found in animal and vegetable fats and oils. Diluting the solution may be necessary for certain applications to achieve a desired concentration or to prevent adverse effects.
What type of lipid is triolein?
Trioelein is a triglyceride. It is derived from glycerol and three units of the unsaturated and oleic acid. Oleic acid is a fatty acid.
What acid is a body fat compound?
Oleic Acid
What is the difference between Oleic acid and Erucic acid?
Banana's
What acid is present in avocados?
oleic acid
Does Oleic acid cause hair loss?
Actually, oleic acid becomes azelaic acid in your body, which may be useful as a hair stimulant! from http://www.raztec.com/azelaic.html
At room temperature acetic acid is?
Acetic acid is a liquid at the room temperature and pressure.
