0
What else can I help you with?
What is net ionic equation for aluminum bromide and silver acetate?
The net ionic equation for aluminum bromide and silver acetate is: Al^3+ + 3Br^- + 3Ag^+ + 3C2H3O2^- -> 3AgBr + Al^3+ + 3C2H3O2^-
Aluminum plus ammonium acetate plus 8-hydroxyquinoline?
when 8-hydroxyquinoline and aluminum reacts a yellow ppt is formed( aluminum-8-hydroxyquinolate) .....but bot sure bout d ammonium acetate. I kno the ammonium acetate helps the helps the precipitate to form.....hope someone can fill the blanks...
Net ionic equation for a solution of sodium acetate and a solution of ammonium sulfate?
The net ionic equation for mixing sodium acetate and ammonium sulfate solutions would be: 2CH3COO- (aq) + (NH4)2SO4 (aq) -> 2CH3COOH (aq) + (NH4)2SO4 (aq) Overall, the reaction results in the formation of acetic acid and ammonium sulfate.
Net ionic equation for sodium acetate and potassium nitrate?
The net ionic equation for sodium acetate (NaCH3COO) and potassium nitrate (KNO3) is: CH3COO^- + K^+ -> KCH3COO
What is the name of the compound with the formula Al CH3COO 3?
Ca(CH3COO)2 is the chemical formula of calcium acetate.
Solutions of aluminum acetate and lithium hydroxide are mixed?
When an aluminum acetate solution reacts with lithium hydroxide, aluminum hydroxide and lithium acetate are formed. Aluminum hydroxide is a white solid that precipitates out of solution, while lithium acetate remains in solution. This reaction is a double displacement reaction that forms a precipitate.
What is the chemical equation of aluminum iodide and leadII acetate?
It is aprecipitate chemical reaction.The chemical equation of aluminum iodide and leadII acetate is given as follows.. 2AlI3(aq) + 3Pb(C2H3O2)2(aq) --> 3PbI2(s) + 2Al(C2H3O2)3(aq).The above is a balanced equation.
Write a balanced equation to show the reaction of aqueous aluminum acetate with aqueous ammonium phosphate to form solid aluminum phosphate and aqueous ammonium acetate.?
The balanced equation is: 2Al(C2H3O2)3(aq) + 3(NH4)3PO4(aq) → AlPO4(s) + 6NH4C2H3O2(aq)
What is the balanced chemical equation for the reaction acetic acid with aluminium hydroxide to form water and aluminium acetate?
The balanced chemical equation for the reaction between acetic acid (CH3COOH) and aluminum hydroxide (Al(OH)3) to form water and aluminum acetate (Al(CH3COO)3) is: 2CH3COOH + 3Al(OH)3 -> 3H2O + Al(CH3COO)3
What is the balance equation of aluminum acetate and cooper II sulfate?
i have no clue
What is the balanced equation for aluminum acetate and potassium phosphate?
Al(C2H3O2)3 + K3PO4 ==> AlPO4 + 3 C2H3O2Kor looked at another way... Al(CH3COO)3 + K3PO4 ==> AlPO4 + 3 CH3COOK
What is net ionic equation for aluminum bromide and silver acetate?
The net ionic equation for aluminum bromide and silver acetate is: Al^3+ + 3Br^- + 3Ag^+ + 3C2H3O2^- -> 3AgBr + Al^3+ + 3C2H3O2^-
What happens during the reaction between vinegar and aluminum?
When vinegar reacts with aluminum, a chemical reaction occurs that produces hydrogen gas and aluminum acetate. This reaction causes the aluminum to corrode and form a layer of aluminum oxide on its surface.
How does vinegar react with aluminum?
When vinegar comes into contact with aluminum, a chemical reaction occurs that produces hydrogen gas and forms aluminum acetate. This reaction can cause the aluminum to corrode and release bubbles of gas.
What is the balanced equation of barium acetate and potassium iodide?
The balanced chemical equation for the reaction between barium acetate and potassium iodide is: Ba(CH3COO)2 + 2KI -> BaI2 + 2KCH3COO
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the effect of vinegar on aluminum?
When vinegar comes into contact with aluminum, it can cause a chemical reaction that results in the formation of hydrogen gas and aluminum acetate. This reaction can lead to the corrosion and degradation of the aluminum surface over time.
