0
What else can I help you with?
What is chioromphinacol?
Chloramphenicol is an antibiotic, inhibits the synthesis of proteins in bacteria. Aparently Chloramphenicol interfer during the transfer of amino acids from RNA-bound amino acids to Ribosome
What is the chemical composition of Chloroamphenicol suspforulation?
Chloramphenicol is a complicated molecule with the SMILES formula c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]. If you don't read SMILES, that's probably not especially helpful."suspforulation" isn't a real word; I suspect it refers to the formulation and just means that the chloramphenicol is in a water suspension.
Why chloramphenicol causes gray baby syndrome?
Chloramphenicol is metabolized by the liver. A baby's liver is not mature enough to metabolize this drug. Therefore the levels of Chloramphenicol increase in the baby's body, as there is no way for the baby to get rid of the drug. This causes cardiovascular collapse (severe hypotension), cyanosis, flaccidity, and vomiting.
What is the mechanisms of resistance to chloramphenicol?
Chloramphenicol is one of the broad spectrum antibiotic used to treat typhoid fever. Resistance occur by way of mutation in ribosomes, By way of decreased permeability of cell wall and production of inactivating enzyme.
The effect of ampicillin chloramphenicol erythromycin methicillin penicillin streptomycin sulphafurazole tetracycline on staphylococcus albus pseudomonas fluorescents micrococcus luteus baci?
Ampicillin, erythromycin, penicillin, and methicillin are effective against Staphylococcus albus but not against Pseudomonas fluorescens. Chloramphenicol, erythromycin, and streptomycin are effective against Pseudomonas fluorescens. Chloramphenicol and erythromycin are effective against Micrococcus luteus. Tetracycline is effective against Bacillus sp., including Bacillus subtilis. Sulphafurazole is effective against many gram-negative bacteria, including Pseudomonas fluorescens.
What has the author Stephen Michael Kane written?
Stephen Michael Kane has written: 'The clinical pharmacokinetics of chloramphenicol and chloramphenicol succinate'
Is chloramphenicol an aminoglycoside?
No, it is a class apart.
What is centimeters antibiotics?
Cm is an abbreviation for chloramphenicol
What liquid antibiotic starts with ch?
CHLORAMPHENICOL OR CHLOROMYCETIN
What is chioromphinacol?
Chloramphenicol is an antibiotic, inhibits the synthesis of proteins in bacteria. Aparently Chloramphenicol interfer during the transfer of amino acids from RNA-bound amino acids to Ribosome
What harm is caused if you swallow chloramphenicol?
i just did, and if i die tmr...
What is an amphenicol?
An amphenicol is any of a class of antibiotic related to chloramphenicol.
What drug is used to treat typhoid fever and brain abscesses?
Chloramphenicol
How do you use chloramphenicol ointment?
use as directed or q 6 hours.
What is the chemical composition of Chloroamphenicol suspforulation?
Chloramphenicol is a complicated molecule with the SMILES formula c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]. If you don't read SMILES, that's probably not especially helpful."suspforulation" isn't a real word; I suspect it refers to the formulation and just means that the chloramphenicol is in a water suspension.
What is the Source of chlorampenicol?
Chloramphenicol, also known as chlornitromycin, was originally made from the Streptomyces venezuelae bacteria. Currently, most chloramphenicol is synthetic; in fact, it was the first antibiotic to be made synthetically in high volume.
What type of antimicrobial agent is chloramphenicol?
Chloramphenicol is a broad-spectrum antibiotic that inhibits bacterial protein synthesis by binding to the 50S ribosomal subunit. It is bacteriostatic and can be effective against a wide range of bacteria, making it useful for treating various types of infections. However, its use is limited due to potential serious side effects, including bone marrow suppression.
