answersLogoWhite

0

Pb + CrCl2 = PbCl2 + Cr

considered a redox single replacement and the Cr has a +2 charge so we assume the Pb also has a +2 because it is a transition metal

User Avatar

Wiki User

∙ 14y ago

What else can I help you with?

Related Questions

What is the balanced equation for zinc plus lead nitrate yield zinc nitrate plus lead?

Equation is Zn + Pb(NO3)2 --> Zn(NO3)2 + Pb


What is name of CrCl2?

The name of CrCl2 is chromium (II) chloride.


What does lead plus hydrogen nitrate yield?

Lead reacts with hydrogen nitrate to form lead(II) nitrate and hydrogen gas. The balanced chemical equation for this reaction is: Pb + 4HNO3 → Pb(NO3)2 + 2H2


Coding in c plus plus to swap two nos using pointer?

void swap (int &pa, int &pb) { *pa ^= *pb; *pb ^= *pa; *pa ^= *pb; }


How does Pb 2 plus become Pb 4 plus?

a peanut buter and jelly or jam sandwich


What is the percent yield of the decomposition reaction if 9.9 grams Pb(NO3) are heated to give an actual yield of 5.5 grams of PbO?

The yield is 82,45 %.


How do you balance Pbo plus C equals Pb plus CO2?

2 PbO + C -> 2 Pb + CO2


What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?

NI(NO3)3+pbbr4nibr3+pb(no3)4


What is the correct cell notation for the redox reaction 3Pb2 plus aq plus 2Cr s 3Pb s plus 2Cr3 plus aq?

Cr(s) | Cr3+(aq) Pb2+(aq) | Pb(s)


How to balance Pb plus pbo2 plus h2so4 H2O plus pbso4?

To balance the chemical equation Pb + PbO2 + H2SO4 → H2O + PbSO4, start by balancing the Pb atoms on the left side by adding a coefficient of 2 in front of Pb on the left side. Then balance the SO4 atoms by adding a coefficient of 4 in front of H2SO4. The balanced equation is 2Pb + PbO2 + 4H2SO4 → 2H2O + 2PbSO4.


What is the total number of electrons in an Pb plus 4?

Pb which is neutral has 82 electrons. Thus, if it has a 4+ charge, then it has 78 electrons.


Nmae the following compound Pb plus 2?

Lead (II)