0
Vinegar
Vinegar is a weak acid created through fermentation. Vinegar can be made from many ingredients such as wine, corn, coconut, malt, or rice.
1,209 Questions
What happens when you put an egg in vinegar for 24 hours?
I think that the egg will float but I didn't do the experiment yet so i don't know.
Are pickled pigs feet actually pickled you know soaked in vinegar?
they are soaked in a brine, almost like a pickle brine, just with different spices, but one of the main ingredients in any brine is vinegar
Can you substitute lemon juice for apple cider vinegar?
nothing really, but if you drink it it will taste like vinger that has been put lemon. and i guess it cleans your system
Why does bleach evaporate faster than vinegar?
Well because Vinegar as more acid than bleach which makes it evaporate faster, and because bleaches chemicals are more adapted to the air.
Why do you use vinegar in cooking?
Yes white vinegar is commonly used in non veg food.
- Wine vinegar is an acid and is commonly used to cut greasiness and make a sauce from the pan drippings. It is also used with oil to make dressings.
to make the food you are preparing taste nice ,also to cut out all unwanted grease and make a nice sauce from the pan drippings
What will happen in the iron nail after 3 days if its exposed to vinegar?
If it is a new nail it will probably just turn dark. If it's a rusty nail it will become rust free.
Why does lemon juice and baking soda have more pressure than vinegar and baking soda?
lemon juice and baking soda. :>
Why you add vinegar in pickles?
I do believe that cucumbers are soaked in vinigar for a lonnggg time
and after the long while a pickle is made :D
How long does it take to clean your system out with vinegar and water?
vinegar does not cleanse your system of marijuana
Is distilled white vinegar the same as undiluted white vinegar?
Undiluted vinegar is a type of vinegar that has not been diluted or flavored with other ingredients. Distilled vinegar and undiluted vinegar are typically the same product.
How much amount of baking soda and vinegar inflate a balloon?
Yes. Mixing vinegar and baking soda releases carbon dioxide (CO2) gas. If you can add the two together and quickly attach a balloon to the container (and close any other openings), the balloon will inflate with CO2
Why will baking soda and vinegar fill up a balloon?
Yes! if you have too much of one then it cannot completely react but will fill the balloon up 100% comparatively. if you have the right amount then it will not waste a lot and will fill up the balloon 90% comparatively. if you don't add enough of one then you will fill it up a lot less like 50% comparatively. (but one of the ingredients has to be constant)
Yes, vinegar can kill weeds if it is weakly diluted in water and if the area of application is compact enough. But its effects will be non-selective and potentially fatal for any edibles or ornamentals in the treatment zone.
What are the benefits of apple cider vinegar and honey?
It also acts as a natural antibiotic; it helps with digestion, Arthritis, and sore throats; it lowers cholesterol; it keeps your skin healthy; it prevents dandruff; and soothes sunburn, shingles, aching muscles, etc.
Apple cider (Or any red based vinegar) also acts as a remedy for heart burn, due to it's acidity compounds, it neutralizes the acid imbalance and will relieve one from Heart burn(Acid reflux) in about 15/20 seconds.
Can limestone be separated from fossils by using vinegar?
When you put limestone into vinegar, it will shift around and sometimes create bubbles.
How long does it take to dissolve an egg shell in vinegar?
yes egg shells can disintegrate in vinegar.
Can you substitute white vinegar for white wine vinegar in making pickles?
Not recommend. You would be losing the salt, spices and sugars. Not to mention the vinegar dilution. The pickle fruit/vegetable has its own juices and have diluted the vinegar by about 3 parts vinegar and 2 part other.
When baking soda is combined with vinegar what new substance is produced?
Yes, when you mix baking soda and vinegar a chemical reaction occurs that is irreversible and creates an alkali salt and carbonic acid.
Because that is just a natural property of acetic acid, which is the chemical name for what is in vinegar. White vinegar is just acetic acid and enough water to give a 5% concentration. Dark vinegar is natural vinegar which has been filtered, but not distilled. While they smell different, they both have the acetic acid smell in common.
Can vinegar turn an egg brown?
Because vinegar dissolves the hard outer shell of the egg, resulting in a transparent membrane over the insides of the egg. But be careful! Do not squeeze the soft egg too hard, or it will burst.
Does vinegar diluted with water still have a chemical reaction with baking soda?
HC2H3O2(aq) + NaHCO3 (s) --> NaC2H3O2(aq) + CO2(g) + H2O(l)
This equation is balanced.
In other terms:
Vinegar and baking soda reacts to form sodium acetate in solution, carbon dioxide gas, and water. The "fizz" that is seen is the production of carbon dioxide gas.
-----------------------------------------------------------------------------------------------------
CH3COOH(aq)+NaHCO3(s)--------- CH3COONa(aq)+H2O(l)+CO2(g)
Which vinegar has a bigger reaction to baking soda apple cider vinegar or regular vinegar?
the type of vinegar that has a bigger reaction to baking soda out of this to type apple cider or white distilled vinegar is white distilled vinegar.
