0
Carbon has a charge of -4 by itself. Each hydrogen atom contributes +1, so the net charge then, is -2.
Emmanuel Bednar
Wiki User
∙ 14y ago1 carbon and 3 hydrogens its a molocule not an element
Michelle Konrad
Wiki User
∙ 13y agoThere are 4 atoms, one carbon atom + three hydrogen atoms.
Wiki User
∙ 9y agoThe charge of CH3 is positive 1.
Add your answer:
Earn +20 pts
What is the molecular formula of the Methyl Group?
The molecular formula of the methyl group is CH3. It consists of one carbon atom bonded to three hydrogen atoms.
How many atoms of hydrogen are in methyl?
There are three atoms of hydrogen in the methyl group (CH3).
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the structure for ethanol?
Ethanol has a chemical formula of C2H5OH and a linear structure with two carbon atoms bonded to each other, with one carbon atom bonded to three hydrogen atoms and the other carbon atom bonded to one hydrogen atom and one hydroxyl group (-OH).
What is the name of C4H8?
C14 H 28 has 14 carbon atoms and 28 hydrogen atoms it is not an alkane though it is an alkene because the formula for alkanes is Cn H2n+2 whereas alkenes have the formula Cn H2n so if you apply the 14 carbon atoms to the first part of the equation so C14 then the amount of hydrogen atoms has to be two times that amount and what is 14 times 2? 28! So it must be an alkene!
How many carbon atoms are found in the chemical formula of propane?
Propane has a chemical formula of C3H8, which means there are 3 carbon atoms in a molecule of propane.
Is CH3 -CH2 -CH3 a pentane?
No, CH3-CH2-CH3 is not a pentane. It is actually propane, which has three carbon atoms in a chain. Pentane would have a chain of five carbon atoms.
How many secondary hydrogen atoms in propane?
Propane is CH3-CH2-CH3. There are six primary carbons and two secondary carbons (CH2) in propane.
What is the atomicity of CH3?
4 atoms are present in one molecule of CH3 So it is Polyatomic
How many carbon atoms are in the compound Dimethyl ether?
Chemical structure: CH3 - O - CH3 so 2 Carbons, one in each methyl group
How many proton nmr signals would you expect for ch3 ch2 ch3?
You would expect three proton NMR signals for CH3CH2CH3: one signal for the two methyl (CH3) groups, one signal for the methylene (CH2) group in the middle, and one signal for the other methyl (CH3) group.
What is the chemical name for CH3 CH3?
CH3 is 1 atom carbon-dioxide(carbon for short) to 3 atoms of helium. But it's not methane - methane is CH4.
How many electrons are associated with carbocation?
A carbocation typically has six electrons associated with it - four from the C atom's original valence electrons and two electrons from the bond that broke to form the carbocation.
Can carbon atoms bond together to create inorganic structures?
ch3
Is CH3- polar?
No, CH3CH3, or ethane, is not polar. It is considered nonpolar because it does not have strongly charged negative or positive hydrogen or carbon atoms.
What is the total number of atoms in the molecule?
there are 9 atoms in a molecule of ethanol. its molecular formula is : CH3, CH2, OH
A -CH3 group is a group?
A -CH3 group is a methyl group. It consists of a carbon atom bonded to three hydrogen atoms, making it a simple alkyl group.
