0
Carbon has a charge of -4 by itself. Each hydrogen atom contributes +1, so the net charge then, is -2.
Emmanuel Bednar
Wiki User
∙ 14y ago1 carbon and 3 hydrogens its a molocule not an element
Michelle Konrad
Wiki User
∙ 13y agoThere are 4 atoms, one carbon atom + three hydrogen atoms.
Wiki User
∙ 9y agoThe charge of CH3 is positive 1.
Add your answer:
Earn +20 pts
What is the structure for ethanol?
tetrahedral (i had this question for lab work online)
Three elements in the compound called ethanol?
2 Carbon atoms 6 Hydrogen atoms 1 Oxygen atoms CH3-CH2-OH a.k.a C2H5OH a.k.a C2H6O
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the name of C4H8?
C14 H 28 has 14 carbon atoms and 28 hydrogen atoms it is not an alkane though it is an alkene because the formula for alkanes is Cn H2n+2 whereas alkenes have the formula Cn H2n so if you apply the 14 carbon atoms to the first part of the equation so C14 then the amount of hydrogen atoms has to be two times that amount and what is 14 times 2? 28! So it must be an alkene!
What type of reaction between chlorine and butane?
This reaction is of a substitution type by a 'alkyl-radical' mechanism:Cl2 + CH3-CH2-CH2-CH3 --> CH2Cl-CH2-CH2-CH3 + HClor (a bit more in favor)Cl2 + CH3-CH2-CH2-CH3 --> CH3-CHCl-CH2-CH3 + HCl
How many carbon atoms are found in the chemical formula of propane?
CH3-CH2-CH3 = PROPANE. there are there carbon atoms.
How many secondary hydrogen atoms in propane?
Propane is CH3-CH2-CH3. There are six primary carbons and two secondary carbons (CH2) in propane.
What is the atomicity of CH3?
4 atoms are present in one molecule of CH3 So it is Polyatomic
How many carbon atoms are in the compound Dimethyl ether?
Chemical structure: CH3 - O - CH3 so 2 Carbons, one in each methyl group
How many proton nmr signals would you expect for ch3 ch2 ch3?
Two: One from the six hydrogen atoms that are part of methyl groups and a second from the two hydrogen atoms that are attached to the central carbon atom.
What is the chemical name for CH3 CH3?
CH3 is 1 atom carbon-dioxide(carbon for short) to 3 atoms of helium. But it's not methane - methane is CH4.
How many atoms are in H3COCH3?
There is a total of Eight Atoms. One carbon, three hydrogen, one carbon, oxygen, oxygen, Hydrogen.
How many electrons are associated with carbocation?
Carbocations are organic species. They are carbon with positive charge, with six electrons on the carbon and have three sigma bonded atoms. eg: CH3+, (CH3)3C+ etc.
Can carbon atoms bond together to create inorganic structures?
ch3
Is CH3- polar?
No, CH3CH3, or ethane, is not polar. It is considered nonpolar because it does not have strongly charged negative or positive hydrogen or carbon atoms.
Is CH3 -CH2 -CH3 a pentane?
No. The formula is for propane, not pentane. A pentane would have five carbon atoms, and this formula shows only three.
What is the total number of atoms in the molecule?
there are 9 atoms in a molecule of ethanol. its molecular formula is : CH3, CH2, OH
