0
2-butyne
Skylar Hagenes
Add your answer:
Earn +20 pts
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the atomicity of CH3?
4 atoms are present in one molecule of CH3 So it is Polyatomic
What is the name of ch3-ch2-ch2-ch3 with single bondof ch3?
Butane
What is the name of compound CH3 3?
2,2,3-tri-methyl-butane is the name of: (CH3)2-CH-C-(CH3)3 or reversely written: (CH3)3-C-CH-(CH3)2
Is ch3 a organic molecule?
yes because it contains carbon so it is organic
What is the name for this molecule ch3 ch2 ch3?
Propane
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name for the molecule ch3?
CH3 is not the formula for any stable molecule; it is the formula of a "methyl radical".
What does CH3 mean in science?
CH3 is a methyl radical. It is part of a larger, organic molecule.
What is the atomicity of CH3?
4 atoms are present in one molecule of CH3 So it is Polyatomic
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
Is the molecule CH C CH3 of 1-propane?
It is propyne
Which molecule is more likely to exist in nature a molecule of CH3 or a molecule of CH4 Explain?
The molecule of methane is more stable, carbon is tetravalent.
What is the name of ch3-ch2-ch2-ch3 with single bondof ch3?
Butane
What is the name of compound CH3 3?
2,2,3-tri-methyl-butane is the name of: (CH3)2-CH-C-(CH3)3 or reversely written: (CH3)3-C-CH-(CH3)2
What is the name of ch3 ch2 ch2 ch3?
Butane
